About 2-(cyclohexa-1,5-dien-1-ylamino)-1-phenyl-5-(trifluoromethyl)-1,8-naphthyridin-4-one
2-(cyclohexa-1,5-dien-1-ylamino)-1-phenyl-5-(trifluoromethyl)-1,8-naphthyridin-4-one (PubChem CID 142224568) has the molecular formula C21H16F3N3O
and a molecular weight of 383.37 g/mol. Its IUPAC name is 2-(cyclohexa-1,5-dien-1-ylamino)-1-phenyl-5-(trifluoromethyl)-1,8-naphthyridin-4-one.
Molecular Properties
| Compound Name | 2-(cyclohexa-1,5-dien-1-ylamino)-1-phenyl-5-(trifluoromethyl)-1,8-naphthyridin-4-one |
| PubChem CID | 142224568 |
| Molecular Formula | C21H16F3N3O |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 2-(cyclohexa-1,5-dien-1-ylamino)-1-phenyl-5-(trifluoromethyl)-1,8-naphthyridin-4-one |
| SMILES | O=c1cc(NC2=CCCC=C2)n(-c2ccccc2)c2nccc(C(F)(F)F)c12 |
| InChI | InChI=1S/C21H16F3N3O/c22-21(23,24)16-11-12-25-20-19(16)17(28)13-18(26-14-7-3-1-4-8-14)27(20)15-9-5-2-6-10-15/h2-3,5-13,26H,1,4H2 |
| InChIKey | YCJINFBOLWJMKM-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(cyclohexa-1,5-dien-1-ylamino)-1-phenyl-5-(trifluoromethyl)-1,8-naphthyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclohexa-1,5-dien-1-ylamino)-1-phenyl-5-(trifluoromethyl)-1,8-naphthyridin-4-one?
The IUPAC name of 2-(cyclohexa-1,5-dien-1-ylamino)-1-phenyl-5-(trifluoromethyl)-1,8-naphthyridin-4-one (CID 142224568) is 2-(cyclohexa-1,5-dien-1-ylamino)-1-phenyl-5-(trifluoromethyl)-1,8-naphthyridin-4-one.
What is the SMILES notation for 2-(cyclohexa-1,5-dien-1-ylamino)-1-phenyl-5-(trifluoromethyl)-1,8-naphthyridin-4-one?
The canonical SMILES for 2-(cyclohexa-1,5-dien-1-ylamino)-1-phenyl-5-(trifluoromethyl)-1,8-naphthyridin-4-one is O=c1cc(NC2=CCCC=C2)n(-c2ccccc2)c2nccc(C(F)(F)F)c12.
What is the InChIKey of 2-(cyclohexa-1,5-dien-1-ylamino)-1-phenyl-5-(trifluoromethyl)-1,8-naphthyridin-4-one?
The InChIKey is YCJINFBOLWJMKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16F3N3O/c22-21(23,24)16-11-12-25-20-19(16)17(28)13-18(26-14-7-3-1-4-8-14)27(20)15-9-5-2-6-10-15/h2-3,5-13,26H,1,4H2.
What are the key properties of 2-(cyclohexa-1,5-dien-1-ylamino)-1-phenyl-5-(trifluoromethyl)-1,8-naphthyridin-4-one?
2-(cyclohexa-1,5-dien-1-ylamino)-1-phenyl-5-(trifluoromethyl)-1,8-naphthyridin-4-one has a molecular weight of 383.37 g/mol, XLogP of 5.05, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclohexa-1,5-dien-1-ylamino)-1-phenyl-5-(trifluoromethyl)-1,8-naphthyridin-4-one is sourced from PubChem (CID 142224568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).