C25H24F3N3O4 — CID 142224612
2-(cyclohexa-1,5-dien-1-ylamino)-1-phenyl-7-propoxy-5-(trifluoromethyl)-1,8-naphthyridin-4-one;formic acid (PubChem CID 142224612) has the molecular formula C25H24F3N3O4 and a molecular weight of 487.48 g/mol. Its IUPAC name is 2-(cyclohexa-1,5-dien-1-ylamino)-1-phenyl-7-propoxy-5-(trifluoromethyl)-1,8-naphthyridin-4-one;formic acid.
| Compound Name | 2-(cyclohexa-1,5-dien-1-ylamino)-1-phenyl-7-propoxy-5-(trifluoromethyl)-1,8-naphthyridin-4-one;formic acid |
|---|---|
| PubChem CID | 142224612 |
| Molecular Formula | C25H24F3N3O4 |
| Molecular Weight | 487.48 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | 2-(cyclohexa-1,5-dien-1-ylamino)-1-phenyl-7-propoxy-5-(trifluoromethyl)-1,8-naphthyridin-4-one;formic acid |
| SMILES | CCCOc1cc(C(F)(F)F)c2c(=O)cc(NC3=CCCC=C3)n(-c3ccccc3)c2n1.O=CO |
| InChI | InChI=1S/C24H22F3N3O2.CH2O2/c1-2-13-32-21-14-18(24(25,26)27)22-19(31)15-20(28-16-9-5-3-6-10-16)30(23(22)29-21)17-11-7-4-8-12-17;2-1-3/h4-5,7-12,14-15,28H,2-3,6,13H2,1H3;1H,(H,2,3) |
| InChIKey | ZIBBSGRXHYRXNS-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.48 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|