C28H31F3N4O2 — CID 142224726
2-anilino-1-phenyl-5-(trifluoromethyl)-1,8-naphthyridin-4-one;butane;N,N-dimethylformamide (PubChem CID 142224726) has the molecular formula C28H31F3N4O2 and a molecular weight of 512.58 g/mol. Its IUPAC name is 2-anilino-1-phenyl-5-(trifluoromethyl)-1,8-naphthyridin-4-one;butane;N,N-dimethylformamide.
| Compound Name | 2-anilino-1-phenyl-5-(trifluoromethyl)-1,8-naphthyridin-4-one;butane;N,N-dimethylformamide |
|---|---|
| PubChem CID | 142224726 |
| Molecular Formula | C28H31F3N4O2 |
| Molecular Weight | 512.58 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | 2-anilino-1-phenyl-5-(trifluoromethyl)-1,8-naphthyridin-4-one;butane;N,N-dimethylformamide |
| SMILES | CCCC.CN(C)C=O.O=c1cc(Nc2ccccc2)n(-c2ccccc2)c2nccc(C(F)(F)F)c12 |
| InChI | InChI=1S/C21H14F3N3O.C4H10.C3H7NO/c22-21(23,24)16-11-12-25-20-19(16)17(28)13-18(26-14-7-3-1-4-8-14)27(20)15-9-5-2-6-10-15;1-3-4-2;1-4(2)3-5/h1-13,26H;3-4H2,1-2H3;3H,1-2H3 |
| InChIKey | WDTPHQSYSIHLPJ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.58 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|