C23H22FN3O — CID 142224993
6-fluoro-2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-1-phenyl-5-propyl-1,8-naphthyridin-4-one (PubChem CID 142224993) has the molecular formula C23H22FN3O and a molecular weight of 375.45 g/mol. Its IUPAC name is 6-fluoro-2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-1-phenyl-5-propyl-1,8-naphthyridin-4-one.
| Compound Name | 6-fluoro-2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-1-phenyl-5-propyl-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 142224993 |
| Molecular Formula | C23H22FN3O |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 6-fluoro-2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-1-phenyl-5-propyl-1,8-naphthyridin-4-one |
| SMILES | C=C/C=C(\C=C)Nc1cc(=O)c2c(CCC)c(F)cnc2n1-c1ccccc1 |
| InChI | InChI=1S/C23H22FN3O/c1-4-10-16(6-3)26-21-14-20(28)22-18(11-5-2)19(24)15-25-23(22)27(21)17-12-8-7-9-13-17/h4,6-10,12-15,26H,1,3,5,11H2,2H3/b16-10+ |
| InChIKey | JPZJFKTUYAJKDV-MHWRWJLKSA-N |
| XLogP | 5.15 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|