About 8-anilino-4-cyclopentyloxy-2-methyl-9-phenyl-5H-pyrido[2,3-b]azepin-6-one;molecular hydrogen
8-anilino-4-cyclopentyloxy-2-methyl-9-phenyl-5H-pyrido[2,3-b]azepin-6-one;molecular hydrogen (PubChem CID 142225090) has the molecular formula C27H29N3O2
and a molecular weight of 427.55 g/mol. Its IUPAC name is 8-anilino-4-cyclopentyloxy-2-methyl-9-phenyl-5H-pyrido[2,3-b]azepin-6-one;molecular hydrogen.
Molecular Properties
| Compound Name | 8-anilino-4-cyclopentyloxy-2-methyl-9-phenyl-5H-pyrido[2,3-b]azepin-6-one;molecular hydrogen |
| PubChem CID | 142225090 |
| Molecular Formula | C27H29N3O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | 8-anilino-4-cyclopentyloxy-2-methyl-9-phenyl-5H-pyrido[2,3-b]azepin-6-one;molecular hydrogen |
| SMILES | Cc1cc(OC2CCCC2)c2c(n1)N(c1ccccc1)C(Nc1ccccc1)=CC(=O)C2.[H][H] |
| InChI | InChI=1S/C27H27N3O2.H2/c1-19-16-25(32-23-14-8-9-15-23)24-17-22(31)18-26(29-20-10-4-2-5-11-20)30(27(24)28-19)21-12-6-3-7-13-21;/h2-7,10-13,16,18,23,29H,8-9,14-15,17H2,1H3;1H |
| InChIKey | KTKKNJRQPZZDCQ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-anilino-4-cyclopentyloxy-2-methyl-9-phenyl-5H-pyrido[2,3-b]azepin-6-one;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-anilino-4-cyclopentyloxy-2-methyl-9-phenyl-5H-pyrido[2,3-b]azepin-6-one;molecular hydrogen?
The IUPAC name of 8-anilino-4-cyclopentyloxy-2-methyl-9-phenyl-5H-pyrido[2,3-b]azepin-6-one;molecular hydrogen (CID 142225090) is 8-anilino-4-cyclopentyloxy-2-methyl-9-phenyl-5H-pyrido[2,3-b]azepin-6-one;molecular hydrogen.
What is the SMILES notation for 8-anilino-4-cyclopentyloxy-2-methyl-9-phenyl-5H-pyrido[2,3-b]azepin-6-one;molecular hydrogen?
The canonical SMILES for 8-anilino-4-cyclopentyloxy-2-methyl-9-phenyl-5H-pyrido[2,3-b]azepin-6-one;molecular hydrogen is Cc1cc(OC2CCCC2)c2c(n1)N(c1ccccc1)C(Nc1ccccc1)=CC(=O)C2.[H][H].
What is the InChIKey of 8-anilino-4-cyclopentyloxy-2-methyl-9-phenyl-5H-pyrido[2,3-b]azepin-6-one;molecular hydrogen?
The InChIKey is KTKKNJRQPZZDCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H27N3O2.H2/c1-19-16-25(32-23-14-8-9-15-23)24-17-22(31)18-26(29-20-10-4-2-5-11-20)30(27(24)28-19)21-12-6-3-7-13-21;/h2-7,10-13,16,18,23,29H,8-9,14-15,17H2,1H3;1H.
What are the key properties of 8-anilino-4-cyclopentyloxy-2-methyl-9-phenyl-5H-pyrido[2,3-b]azepin-6-one;molecular hydrogen?
8-anilino-4-cyclopentyloxy-2-methyl-9-phenyl-5H-pyrido[2,3-b]azepin-6-one;molecular hydrogen has a molecular weight of 427.55 g/mol, XLogP of 6.17, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-anilino-4-cyclopentyloxy-2-methyl-9-phenyl-5H-pyrido[2,3-b]azepin-6-one;molecular hydrogen is sourced from PubChem (CID 142225090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).