About 2,4-dimethyl-6,6a-dihydro-5aH-cyclopropa[g]quinoline;ethane
2,4-dimethyl-6,6a-dihydro-5aH-cyclopropa[g]quinoline;ethane (PubChem CID 142225187) has the molecular formula C14H19N
and a molecular weight of 201.31 g/mol. Its IUPAC name is 2,4-dimethyl-6,6a-dihydro-5aH-cyclopropa[g]quinoline;ethane.
Molecular Properties
| Compound Name | 2,4-dimethyl-6,6a-dihydro-5aH-cyclopropa[g]quinoline;ethane |
| PubChem CID | 142225187 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 2,4-dimethyl-6,6a-dihydro-5aH-cyclopropa[g]quinoline;ethane |
| SMILES | CC.Cc1cc(C)c2c(n1)=CC1CC1C=2 |
| InChI | InChI=1S/C12H13N.C2H6/c1-7-3-8(2)13-12-6-10-4-9(10)5-11(7)12;1-2/h3,5-6,9-10H,4H2,1-2H3;1-2H3 |
| InChIKey | MOGIJFQLYARLAQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4-dimethyl-6,6a-dihydro-5aH-cyclopropa[g]quinoline;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-6,6a-dihydro-5aH-cyclopropa[g]quinoline;ethane?
The IUPAC name of 2,4-dimethyl-6,6a-dihydro-5aH-cyclopropa[g]quinoline;ethane (CID 142225187) is 2,4-dimethyl-6,6a-dihydro-5aH-cyclopropa[g]quinoline;ethane.
What is the SMILES notation for 2,4-dimethyl-6,6a-dihydro-5aH-cyclopropa[g]quinoline;ethane?
The canonical SMILES for 2,4-dimethyl-6,6a-dihydro-5aH-cyclopropa[g]quinoline;ethane is CC.Cc1cc(C)c2c(n1)=CC1CC1C=2.
What is the InChIKey of 2,4-dimethyl-6,6a-dihydro-5aH-cyclopropa[g]quinoline;ethane?
The InChIKey is MOGIJFQLYARLAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N.C2H6/c1-7-3-8(2)13-12-6-10-4-9(10)5-11(7)12;1-2/h3,5-6,9-10H,4H2,1-2H3;1-2H3.
What are the key properties of 2,4-dimethyl-6,6a-dihydro-5aH-cyclopropa[g]quinoline;ethane?
2,4-dimethyl-6,6a-dihydro-5aH-cyclopropa[g]quinoline;ethane has a molecular weight of 201.31 g/mol, XLogP of 1.94, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-6,6a-dihydro-5aH-cyclopropa[g]quinoline;ethane is sourced from PubChem (CID 142225187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).