C25H26F3N3O2 — CID 142225473
acetylene;7-ethoxy-1-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-5-(trifluoromethyl)-1,8-naphthyridin-4-one (PubChem CID 142225473) has the molecular formula C25H26F3N3O2 and a molecular weight of 457.50 g/mol. Its IUPAC name is acetylene;7-ethoxy-1-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-5-(trifluoromethyl)-1,8-naphthyridin-4-one.
| Compound Name | acetylene;7-ethoxy-1-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-5-(trifluoromethyl)-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 142225473 |
| Molecular Formula | C25H26F3N3O2 |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | acetylene;7-ethoxy-1-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-5-(trifluoromethyl)-1,8-naphthyridin-4-one |
| SMILES | C#C.C=C/C=C(\C=C)Nc1cc(=O)c2c(C(F)(F)F)cc(OCC)nc2n1C(/C=C\C)=C/C |
| InChI | InChI=1S/C23H24F3N3O2.C2H2/c1-6-11-15(8-3)27-19-14-18(30)21-17(23(24,25)26)13-20(31-10-5)28-22(21)29(19)16(9-4)12-7-2;1-2/h6-9,11-14,27H,1,3,10H2,2,4-5H3;1-2H/b12-7-,15-11+,16-9+; |
| InChIKey | MXNAJGZRHMZKFJ-FRLYMCRASA-N |
| XLogP | 6.17 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|