C17H24O6 — CID 14222554
3,6,9,12,15-pentaoxabicyclo[15.3.1]henicosa-1(21),17,19-triene-21-carbaldehyde (PubChem CID 14222554) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is 3,6,9,12,15-pentaoxabicyclo[15.3.1]henicosa-1(21),17,19-triene-21-carbaldehyde.
| Compound Name | 3,6,9,12,15-pentaoxabicyclo[15.3.1]henicosa-1(21),17,19-triene-21-carbaldehyde |
|---|---|
| PubChem CID | 14222554 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 3,6,9,12,15-pentaoxabicyclo[15.3.1]henicosa-1(21),17,19-triene-21-carbaldehyde |
| SMILES | O=Cc1c2cccc1COCCOCCOCCOCCOC2 |
| InChI | InChI=1S/C17H24O6/c18-12-17-15-2-1-3-16(17)14-23-11-9-21-7-5-19-4-6-20-8-10-22-13-15/h1-3,12H,4-11,13-14H2 |
| InChIKey | NWBVWCRTYSJLNL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|