C24H19N3OS — CID 142225584
2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-1-phenyl-7-thiophen-2-yl-1,6-naphthyridin-4-one (PubChem CID 142225584) has the molecular formula C24H19N3OS and a molecular weight of 397.50 g/mol. Its IUPAC name is 2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-1-phenyl-7-thiophen-2-yl-1,6-naphthyridin-4-one.
| Compound Name | 2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-1-phenyl-7-thiophen-2-yl-1,6-naphthyridin-4-one |
|---|---|
| PubChem CID | 142225584 |
| Molecular Formula | C24H19N3OS |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 2-[[(3E)-hexa-1,3,5-trien-3-yl]amino]-1-phenyl-7-thiophen-2-yl-1,6-naphthyridin-4-one |
| SMILES | C=C/C=C(\C=C)Nc1cc(=O)c2cnc(-c3cccs3)cc2n1-c1ccccc1 |
| InChI | InChI=1S/C24H19N3OS/c1-3-9-17(4-2)26-24-15-22(28)19-16-25-20(23-12-8-13-29-23)14-21(19)27(24)18-10-6-5-7-11-18/h3-16,26H,1-2H2/b17-9+ |
| InChIKey | AADNNRCUMHFXIM-RQZCQDPDSA-N |
| XLogP | 5.78 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|