About 2-(cyclohexa-1,5-dien-1-ylamino)-8-(hydroxymethyl)-1-phenyl-1,6-naphthyridin-4-one
2-(cyclohexa-1,5-dien-1-ylamino)-8-(hydroxymethyl)-1-phenyl-1,6-naphthyridin-4-one (PubChem CID 142225641) has the molecular formula C21H19N3O2
and a molecular weight of 345.40 g/mol. Its IUPAC name is 2-(cyclohexa-1,5-dien-1-ylamino)-8-(hydroxymethyl)-1-phenyl-1,6-naphthyridin-4-one.
Molecular Properties
| Compound Name | 2-(cyclohexa-1,5-dien-1-ylamino)-8-(hydroxymethyl)-1-phenyl-1,6-naphthyridin-4-one |
| PubChem CID | 142225641 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 2-(cyclohexa-1,5-dien-1-ylamino)-8-(hydroxymethyl)-1-phenyl-1,6-naphthyridin-4-one |
| SMILES | O=c1cc(NC2=CCCC=C2)n(-c2ccccc2)c2c(CO)cncc12 |
| InChI | InChI=1S/C21H19N3O2/c25-14-15-12-22-13-18-19(26)11-20(23-16-7-3-1-4-8-16)24(21(15)18)17-9-5-2-6-10-17/h2-3,5-13,23,25H,1,4,14H2 |
| InChIKey | KDOJECANDDOVJZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(cyclohexa-1,5-dien-1-ylamino)-8-(hydroxymethyl)-1-phenyl-1,6-naphthyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclohexa-1,5-dien-1-ylamino)-8-(hydroxymethyl)-1-phenyl-1,6-naphthyridin-4-one?
The IUPAC name of 2-(cyclohexa-1,5-dien-1-ylamino)-8-(hydroxymethyl)-1-phenyl-1,6-naphthyridin-4-one (CID 142225641) is 2-(cyclohexa-1,5-dien-1-ylamino)-8-(hydroxymethyl)-1-phenyl-1,6-naphthyridin-4-one.
What is the SMILES notation for 2-(cyclohexa-1,5-dien-1-ylamino)-8-(hydroxymethyl)-1-phenyl-1,6-naphthyridin-4-one?
The canonical SMILES for 2-(cyclohexa-1,5-dien-1-ylamino)-8-(hydroxymethyl)-1-phenyl-1,6-naphthyridin-4-one is O=c1cc(NC2=CCCC=C2)n(-c2ccccc2)c2c(CO)cncc12.
What is the InChIKey of 2-(cyclohexa-1,5-dien-1-ylamino)-8-(hydroxymethyl)-1-phenyl-1,6-naphthyridin-4-one?
The InChIKey is KDOJECANDDOVJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N3O2/c25-14-15-12-22-13-18-19(26)11-20(23-16-7-3-1-4-8-16)24(21(15)18)17-9-5-2-6-10-17/h2-3,5-13,23,25H,1,4,14H2.
What are the key properties of 2-(cyclohexa-1,5-dien-1-ylamino)-8-(hydroxymethyl)-1-phenyl-1,6-naphthyridin-4-one?
2-(cyclohexa-1,5-dien-1-ylamino)-8-(hydroxymethyl)-1-phenyl-1,6-naphthyridin-4-one has a molecular weight of 345.40 g/mol, XLogP of 3.52, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclohexa-1,5-dien-1-ylamino)-8-(hydroxymethyl)-1-phenyl-1,6-naphthyridin-4-one is sourced from PubChem (CID 142225641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).