C25H27N3O2 — CID 142225683
acetylene;7-(1-hydroxypropyl)-5-methyl-2-[[(2E)-penta-2,4-dien-2-yl]amino]-1-phenyl-1,8-naphthyridin-4-one (PubChem CID 142225683) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is acetylene;7-(1-hydroxypropyl)-5-methyl-2-[[(2E)-penta-2,4-dien-2-yl]amino]-1-phenyl-1,8-naphthyridin-4-one.
| Compound Name | acetylene;7-(1-hydroxypropyl)-5-methyl-2-[[(2E)-penta-2,4-dien-2-yl]amino]-1-phenyl-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 142225683 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | acetylene;7-(1-hydroxypropyl)-5-methyl-2-[[(2E)-penta-2,4-dien-2-yl]amino]-1-phenyl-1,8-naphthyridin-4-one |
| SMILES | C#C.C=C/C=C(\C)Nc1cc(=O)c2c(C)cc(C(O)CC)nc2n1-c1ccccc1 |
| InChI | InChI=1S/C23H25N3O2.C2H2/c1-5-10-16(4)24-21-14-20(28)22-15(3)13-18(19(27)6-2)25-23(22)26(21)17-11-8-7-9-12-17;1-2/h5,7-14,19,24,27H,1,6H2,2-4H3;1-2H/b16-10+; |
| InChIKey | MODSLDNGNFCKNB-QFHYWFJHSA-N |
| XLogP | 4.89 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|