About ethane;4-(4-fluorophenyl)-5-methyl-2-(4-methyl-3-pyridinyl)-1,3-oxazole
ethane;4-(4-fluorophenyl)-5-methyl-2-(4-methyl-3-pyridinyl)-1,3-oxazole (PubChem CID 142226019) has the molecular formula C18H19FN2O
and a molecular weight of 298.36 g/mol. Its IUPAC name is ethane;4-(4-fluorophenyl)-5-methyl-2-(4-methyl-3-pyridinyl)-1,3-oxazole.
Molecular Properties
| Compound Name | ethane;4-(4-fluorophenyl)-5-methyl-2-(4-methyl-3-pyridinyl)-1,3-oxazole |
| PubChem CID | 142226019 |
| Molecular Formula | C18H19FN2O |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | ethane;4-(4-fluorophenyl)-5-methyl-2-(4-methyl-3-pyridinyl)-1,3-oxazole |
| SMILES | CC.Cc1ccncc1-c1nc(-c2ccc(F)cc2)c(C)o1 |
| InChI | InChI=1S/C16H13FN2O.C2H6/c1-10-7-8-18-9-14(10)16-19-15(11(2)20-16)12-3-5-13(17)6-4-12;1-2/h3-9H,1-2H3;1-2H3 |
| InChIKey | FVYACVIIYCANOW-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;4-(4-fluorophenyl)-5-methyl-2-(4-methyl-3-pyridinyl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-(4-fluorophenyl)-5-methyl-2-(4-methyl-3-pyridinyl)-1,3-oxazole?
The IUPAC name of ethane;4-(4-fluorophenyl)-5-methyl-2-(4-methyl-3-pyridinyl)-1,3-oxazole (CID 142226019) is ethane;4-(4-fluorophenyl)-5-methyl-2-(4-methyl-3-pyridinyl)-1,3-oxazole.
What is the SMILES notation for ethane;4-(4-fluorophenyl)-5-methyl-2-(4-methyl-3-pyridinyl)-1,3-oxazole?
The canonical SMILES for ethane;4-(4-fluorophenyl)-5-methyl-2-(4-methyl-3-pyridinyl)-1,3-oxazole is CC.Cc1ccncc1-c1nc(-c2ccc(F)cc2)c(C)o1.
What is the InChIKey of ethane;4-(4-fluorophenyl)-5-methyl-2-(4-methyl-3-pyridinyl)-1,3-oxazole?
The InChIKey is FVYACVIIYCANOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13FN2O.C2H6/c1-10-7-8-18-9-14(10)16-19-15(11(2)20-16)12-3-5-13(17)6-4-12;1-2/h3-9H,1-2H3;1-2H3.
What are the key properties of ethane;4-(4-fluorophenyl)-5-methyl-2-(4-methyl-3-pyridinyl)-1,3-oxazole?
ethane;4-(4-fluorophenyl)-5-methyl-2-(4-methyl-3-pyridinyl)-1,3-oxazole has a molecular weight of 298.36 g/mol, XLogP of 5.19, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-(4-fluorophenyl)-5-methyl-2-(4-methyl-3-pyridinyl)-1,3-oxazole is sourced from PubChem (CID 142226019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).