About 2-[(E)-3,4-difluoropent-3-enyl]sulfanyl-N-ethyl-1,3-thiazole-5-carboxamide
2-[(E)-3,4-difluoropent-3-enyl]sulfanyl-N-ethyl-1,3-thiazole-5-carboxamide (PubChem CID 142226390) has the molecular formula C11H14F2N2OS2
and a molecular weight of 292.38 g/mol. Its IUPAC name is 2-[(E)-3,4-difluoropent-3-enyl]sulfanyl-N-ethyl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 2-[(E)-3,4-difluoropent-3-enyl]sulfanyl-N-ethyl-1,3-thiazole-5-carboxamide |
| PubChem CID | 142226390 |
| Molecular Formula | C11H14F2N2OS2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 2-[(E)-3,4-difluoropent-3-enyl]sulfanyl-N-ethyl-1,3-thiazole-5-carboxamide |
| SMILES | CCNC(=O)c1cnc(SCC/C(F)=C(/C)F)s1 |
| InChI | InChI=1S/C11H14F2N2OS2/c1-3-14-10(16)9-6-15-11(18-9)17-5-4-8(13)7(2)12/h6H,3-5H2,1-2H3,(H,14,16)/b8-7+ |
| InChIKey | LXGAGFGNDQBAFV-BQYQJAHWSA-N |
| XLogP | 3.55 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-3,4-difluoropent-3-enyl]sulfanyl-N-ethyl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-3,4-difluoropent-3-enyl]sulfanyl-N-ethyl-1,3-thiazole-5-carboxamide?
The IUPAC name of 2-[(E)-3,4-difluoropent-3-enyl]sulfanyl-N-ethyl-1,3-thiazole-5-carboxamide (CID 142226390) is 2-[(E)-3,4-difluoropent-3-enyl]sulfanyl-N-ethyl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 2-[(E)-3,4-difluoropent-3-enyl]sulfanyl-N-ethyl-1,3-thiazole-5-carboxamide?
The canonical SMILES for 2-[(E)-3,4-difluoropent-3-enyl]sulfanyl-N-ethyl-1,3-thiazole-5-carboxamide is CCNC(=O)c1cnc(SCC/C(F)=C(/C)F)s1.
What is the InChIKey of 2-[(E)-3,4-difluoropent-3-enyl]sulfanyl-N-ethyl-1,3-thiazole-5-carboxamide?
The InChIKey is LXGAGFGNDQBAFV-BQYQJAHWSA-N. The full InChI is InChI=1S/C11H14F2N2OS2/c1-3-14-10(16)9-6-15-11(18-9)17-5-4-8(13)7(2)12/h6H,3-5H2,1-2H3,(H,14,16)/b8-7+.
What are the key properties of 2-[(E)-3,4-difluoropent-3-enyl]sulfanyl-N-ethyl-1,3-thiazole-5-carboxamide?
2-[(E)-3,4-difluoropent-3-enyl]sulfanyl-N-ethyl-1,3-thiazole-5-carboxamide has a molecular weight of 292.38 g/mol, XLogP of 3.55, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-3,4-difluoropent-3-enyl]sulfanyl-N-ethyl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 142226390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).