About 2-[N-methyl-4-[(1,3,4-trimethylimidazol-1-ium-2-yl)diazenyl]anilino]ethanol
2-[N-methyl-4-[(1,3,4-trimethylimidazol-1-ium-2-yl)diazenyl]anilino]ethanol (PubChem CID 142226404) has the molecular formula C15H22N5O+
and a molecular weight of 288.38 g/mol. Its IUPAC name is 2-[N-methyl-4-[(1,3,4-trimethylimidazol-1-ium-2-yl)diazenyl]anilino]ethanol.
Molecular Properties
| Compound Name | 2-[N-methyl-4-[(1,3,4-trimethylimidazol-1-ium-2-yl)diazenyl]anilino]ethanol |
| PubChem CID | 142226404 |
| Molecular Formula | C15H22N5O+ |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 2-[N-methyl-4-[(1,3,4-trimethylimidazol-1-ium-2-yl)diazenyl]anilino]ethanol |
| SMILES | Cc1c[n+](C)c(/N=N/c2ccc(N(C)CCO)cc2)n1C |
| InChI | InChI=1S/C15H22N5O/c1-12-11-19(3)15(20(12)4)17-16-13-5-7-14(8-6-13)18(2)9-10-21/h5-8,11,21H,9-10H2,1-4H3/q+1 |
| InChIKey | GWGNCTQLSDPUCD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 57.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[N-methyl-4-[(1,3,4-trimethylimidazol-1-ium-2-yl)diazenyl]anilino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[N-methyl-4-[(1,3,4-trimethylimidazol-1-ium-2-yl)diazenyl]anilino]ethanol?
The IUPAC name of 2-[N-methyl-4-[(1,3,4-trimethylimidazol-1-ium-2-yl)diazenyl]anilino]ethanol (CID 142226404) is 2-[N-methyl-4-[(1,3,4-trimethylimidazol-1-ium-2-yl)diazenyl]anilino]ethanol.
What is the SMILES notation for 2-[N-methyl-4-[(1,3,4-trimethylimidazol-1-ium-2-yl)diazenyl]anilino]ethanol?
The canonical SMILES for 2-[N-methyl-4-[(1,3,4-trimethylimidazol-1-ium-2-yl)diazenyl]anilino]ethanol is Cc1c[n+](C)c(/N=N/c2ccc(N(C)CCO)cc2)n1C.
What is the InChIKey of 2-[N-methyl-4-[(1,3,4-trimethylimidazol-1-ium-2-yl)diazenyl]anilino]ethanol?
The InChIKey is GWGNCTQLSDPUCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N5O/c1-12-11-19(3)15(20(12)4)17-16-13-5-7-14(8-6-13)18(2)9-10-21/h5-8,11,21H,9-10H2,1-4H3/q+1.
What are the key properties of 2-[N-methyl-4-[(1,3,4-trimethylimidazol-1-ium-2-yl)diazenyl]anilino]ethanol?
2-[N-methyl-4-[(1,3,4-trimethylimidazol-1-ium-2-yl)diazenyl]anilino]ethanol has a molecular weight of 288.38 g/mol, XLogP of 2.00, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[N-methyl-4-[(1,3,4-trimethylimidazol-1-ium-2-yl)diazenyl]anilino]ethanol is sourced from PubChem (CID 142226404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).