About ethene;formaldehyde;quinoline
ethene;formaldehyde;quinoline (PubChem CID 142226527) has the molecular formula C12H13NO
and a molecular weight of 187.24 g/mol. Its IUPAC name is ethene;formaldehyde;quinoline.
Molecular Properties
| Compound Name | ethene;formaldehyde;quinoline |
| PubChem CID | 142226527 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | ethene;formaldehyde;quinoline |
| SMILES | C=C.C=O.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C2H4.CH2O/c1-2-6-9-8(4-1)5-3-7-10-9;2*1-2/h1-7H;1-2H2;1H2 |
| InChIKey | CKSZKBZDPGDZRN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;formaldehyde;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;formaldehyde;quinoline?
The IUPAC name of ethene;formaldehyde;quinoline (CID 142226527) is ethene;formaldehyde;quinoline.
What is the SMILES notation for ethene;formaldehyde;quinoline?
The canonical SMILES for ethene;formaldehyde;quinoline is C=C.C=O.c1ccc2ncccc2c1.
What is the InChIKey of ethene;formaldehyde;quinoline?
The InChIKey is CKSZKBZDPGDZRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C2H4.CH2O/c1-2-6-9-8(4-1)5-3-7-10-9;2*1-2/h1-7H;1-2H2;1H2.
What are the key properties of ethene;formaldehyde;quinoline?
ethene;formaldehyde;quinoline has a molecular weight of 187.24 g/mol, XLogP of 2.85, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;formaldehyde;quinoline is sourced from PubChem (CID 142226527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).