About N-[2-(1,1-difluoropropan-2-yl)phenyl]formamide
N-[2-(1,1-difluoropropan-2-yl)phenyl]formamide (PubChem CID 142226533) has the molecular formula C10H11F2NO
and a molecular weight of 199.20 g/mol. Its IUPAC name is N-[2-(1,1-difluoropropan-2-yl)phenyl]formamide.
Molecular Properties
| Compound Name | N-[2-(1,1-difluoropropan-2-yl)phenyl]formamide |
| PubChem CID | 142226533 |
| Molecular Formula | C10H11F2NO |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | N-[2-(1,1-difluoropropan-2-yl)phenyl]formamide |
| SMILES | CC(c1ccccc1NC=O)C(F)F |
| InChI | InChI=1S/C10H11F2NO/c1-7(10(11)12)8-4-2-3-5-9(8)13-6-14/h2-7,10H,1H3,(H,13,14) |
| InChIKey | AJBHVEXPWWDBQG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(1,1-difluoropropan-2-yl)phenyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1,1-difluoropropan-2-yl)phenyl]formamide?
The IUPAC name of N-[2-(1,1-difluoropropan-2-yl)phenyl]formamide (CID 142226533) is N-[2-(1,1-difluoropropan-2-yl)phenyl]formamide.
What is the SMILES notation for N-[2-(1,1-difluoropropan-2-yl)phenyl]formamide?
The canonical SMILES for N-[2-(1,1-difluoropropan-2-yl)phenyl]formamide is CC(c1ccccc1NC=O)C(F)F.
What is the InChIKey of N-[2-(1,1-difluoropropan-2-yl)phenyl]formamide?
The InChIKey is AJBHVEXPWWDBQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F2NO/c1-7(10(11)12)8-4-2-3-5-9(8)13-6-14/h2-7,10H,1H3,(H,13,14).
What are the key properties of N-[2-(1,1-difluoropropan-2-yl)phenyl]formamide?
N-[2-(1,1-difluoropropan-2-yl)phenyl]formamide has a molecular weight of 199.20 g/mol, XLogP of 2.62, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1,1-difluoropropan-2-yl)phenyl]formamide is sourced from PubChem (CID 142226533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).