About 3-[5-bromo-1-(4-fluorophenyl)-2,3-dihydroinden-1-yl]-N,N-dimethylpropan-1-amine
3-[5-bromo-1-(4-fluorophenyl)-2,3-dihydroinden-1-yl]-N,N-dimethylpropan-1-amine (PubChem CID 142226558) has the molecular formula C20H23BrFN
and a molecular weight of 376.31 g/mol. Its IUPAC name is 3-[5-bromo-1-(4-fluorophenyl)-2,3-dihydroinden-1-yl]-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-[5-bromo-1-(4-fluorophenyl)-2,3-dihydroinden-1-yl]-N,N-dimethylpropan-1-amine |
| PubChem CID | 142226558 |
| Molecular Formula | C20H23BrFN |
| Molecular Weight | 376.31 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 3-[5-bromo-1-(4-fluorophenyl)-2,3-dihydroinden-1-yl]-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCC1(c2ccc(F)cc2)CCc2cc(Br)ccc21 |
| InChI | InChI=1S/C20H23BrFN/c1-23(2)13-3-11-20(16-4-7-18(22)8-5-16)12-10-15-14-17(21)6-9-19(15)20/h4-9,14H,3,10-13H2,1-2H3 |
| InChIKey | AAQJDHUTADJWJH-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.31 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[5-bromo-1-(4-fluorophenyl)-2,3-dihydroinden-1-yl]-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-bromo-1-(4-fluorophenyl)-2,3-dihydroinden-1-yl]-N,N-dimethylpropan-1-amine?
The IUPAC name of 3-[5-bromo-1-(4-fluorophenyl)-2,3-dihydroinden-1-yl]-N,N-dimethylpropan-1-amine (CID 142226558) is 3-[5-bromo-1-(4-fluorophenyl)-2,3-dihydroinden-1-yl]-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 3-[5-bromo-1-(4-fluorophenyl)-2,3-dihydroinden-1-yl]-N,N-dimethylpropan-1-amine?
The canonical SMILES for 3-[5-bromo-1-(4-fluorophenyl)-2,3-dihydroinden-1-yl]-N,N-dimethylpropan-1-amine is CN(C)CCCC1(c2ccc(F)cc2)CCc2cc(Br)ccc21.
What is the InChIKey of 3-[5-bromo-1-(4-fluorophenyl)-2,3-dihydroinden-1-yl]-N,N-dimethylpropan-1-amine?
The InChIKey is AAQJDHUTADJWJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23BrFN/c1-23(2)13-3-11-20(16-4-7-18(22)8-5-16)12-10-15-14-17(21)6-9-19(15)20/h4-9,14H,3,10-13H2,1-2H3.
What are the key properties of 3-[5-bromo-1-(4-fluorophenyl)-2,3-dihydroinden-1-yl]-N,N-dimethylpropan-1-amine?
3-[5-bromo-1-(4-fluorophenyl)-2,3-dihydroinden-1-yl]-N,N-dimethylpropan-1-amine has a molecular weight of 376.31 g/mol, XLogP of 5.16, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-bromo-1-(4-fluorophenyl)-2,3-dihydroinden-1-yl]-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 142226558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).