About 2-N-[2-(3-aminopropylamino)ethyl]-1-N-ethyl-3-prop-2-enoxypropane-1,2-diamine
2-N-[2-(3-aminopropylamino)ethyl]-1-N-ethyl-3-prop-2-enoxypropane-1,2-diamine (PubChem CID 142226775) has the molecular formula C13H30N4O
and a molecular weight of 258.41 g/mol. Its IUPAC name is 2-N-[2-(3-aminopropylamino)ethyl]-1-N-ethyl-3-prop-2-enoxypropane-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-[2-(3-aminopropylamino)ethyl]-1-N-ethyl-3-prop-2-enoxypropane-1,2-diamine |
| PubChem CID | 142226775 |
| Molecular Formula | C13H30N4O |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.24 |
| IUPAC Name | 2-N-[2-(3-aminopropylamino)ethyl]-1-N-ethyl-3-prop-2-enoxypropane-1,2-diamine |
| SMILES | C=CCOCC(CNCC)NCCNCCCN |
| InChI | InChI=1S/C13H30N4O/c1-3-10-18-12-13(11-15-4-2)17-9-8-16-7-5-6-14/h3,13,15-17H,1,4-12,14H2,2H3 |
| InChIKey | VHKLFYZCEGJJNU-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-N-[2-(3-aminopropylamino)ethyl]-1-N-ethyl-3-prop-2-enoxypropane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-[2-(3-aminopropylamino)ethyl]-1-N-ethyl-3-prop-2-enoxypropane-1,2-diamine?
The IUPAC name of 2-N-[2-(3-aminopropylamino)ethyl]-1-N-ethyl-3-prop-2-enoxypropane-1,2-diamine (CID 142226775) is 2-N-[2-(3-aminopropylamino)ethyl]-1-N-ethyl-3-prop-2-enoxypropane-1,2-diamine.
What is the SMILES notation for 2-N-[2-(3-aminopropylamino)ethyl]-1-N-ethyl-3-prop-2-enoxypropane-1,2-diamine?
The canonical SMILES for 2-N-[2-(3-aminopropylamino)ethyl]-1-N-ethyl-3-prop-2-enoxypropane-1,2-diamine is C=CCOCC(CNCC)NCCNCCCN.
What is the InChIKey of 2-N-[2-(3-aminopropylamino)ethyl]-1-N-ethyl-3-prop-2-enoxypropane-1,2-diamine?
The InChIKey is VHKLFYZCEGJJNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H30N4O/c1-3-10-18-12-13(11-15-4-2)17-9-8-16-7-5-6-14/h3,13,15-17H,1,4-12,14H2,2H3.
What are the key properties of 2-N-[2-(3-aminopropylamino)ethyl]-1-N-ethyl-3-prop-2-enoxypropane-1,2-diamine?
2-N-[2-(3-aminopropylamino)ethyl]-1-N-ethyl-3-prop-2-enoxypropane-1,2-diamine has a molecular weight of 258.41 g/mol, XLogP of -0.30, 14 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-[2-(3-aminopropylamino)ethyl]-1-N-ethyl-3-prop-2-enoxypropane-1,2-diamine is sourced from PubChem (CID 142226775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).