C24H32O5 — CID 142226806
ethane;(E)-2-methyl-3-(4-propoxyphenyl)-1-(2,3,4-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 142226806) has the molecular formula C24H32O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is ethane;(E)-2-methyl-3-(4-propoxyphenyl)-1-(2,3,4-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | ethane;(E)-2-methyl-3-(4-propoxyphenyl)-1-(2,3,4-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 142226806 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | ethane;(E)-2-methyl-3-(4-propoxyphenyl)-1-(2,3,4-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | CC.CCCOc1ccc(/C=C(\C)C(=O)c2ccc(OC)c(OC)c2OC)cc1 |
| InChI | InChI=1S/C22H26O5.C2H6/c1-6-13-27-17-9-7-16(8-10-17)14-15(2)20(23)18-11-12-19(24-3)22(26-5)21(18)25-4;1-2/h7-12,14H,6,13H2,1-5H3;1-2H3/b15-14+; |
| InChIKey | JUNFYCMNXBWTBY-WPDLWGESSA-N |
| XLogP | 5.81 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|