C10H18N2 — CID 142226968
N'-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-N'-methylethane-1,2-diamine (PubChem CID 142226968) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is N'-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-N'-methylethane-1,2-diamine.
| Compound Name | N'-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 142226968 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | N'-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-N'-methylethane-1,2-diamine |
| SMILES | C=C(/C=C\C=C/C)N(C)CCN |
| InChI | InChI=1S/C10H18N2/c1-4-5-6-7-10(2)12(3)9-8-11/h4-7H,2,8-9,11H2,1,3H3/b5-4-,7-6- |
| InChIKey | ALFSKBAPOPRGCX-RZSVFLSASA-N |
| XLogP | 1.52 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|