C11H19NO2 — CID 142226977
(2E,4E)-5,6-dimethoxy-N,2-dimethylhepta-2,4,6-trien-1-amine (PubChem CID 142226977) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is (2E,4E)-5,6-dimethoxy-N,2-dimethylhepta-2,4,6-trien-1-amine.
| Compound Name | (2E,4E)-5,6-dimethoxy-N,2-dimethylhepta-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 142226977 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | (2E,4E)-5,6-dimethoxy-N,2-dimethylhepta-2,4,6-trien-1-amine |
| SMILES | C=C(OC)/C(=C\C=C(/C)CNC)OC |
| InChI | InChI=1S/C11H19NO2/c1-9(8-12-3)6-7-11(14-5)10(2)13-4/h6-7,12H,2,8H2,1,3-5H3/b9-6+,11-7+ |
| InChIKey | RWDJCUGEQWBLBL-QHAIXMIYSA-N |
| XLogP | 1.84 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|