About N-[(5,6-dimethyl-2,3-dihydro-1H-pyridin-6-yl)methyl]propan-1-amine
N-[(5,6-dimethyl-2,3-dihydro-1H-pyridin-6-yl)methyl]propan-1-amine (PubChem CID 142227131) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is N-[(5,6-dimethyl-2,3-dihydro-1H-pyridin-6-yl)methyl]propan-1-amine.
Molecular Properties
| Compound Name | N-[(5,6-dimethyl-2,3-dihydro-1H-pyridin-6-yl)methyl]propan-1-amine |
| PubChem CID | 142227131 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | N-[(5,6-dimethyl-2,3-dihydro-1H-pyridin-6-yl)methyl]propan-1-amine |
| SMILES | CCCNCC1(C)NCCC=C1C |
| InChI | InChI=1S/C11H22N2/c1-4-7-12-9-11(3)10(2)6-5-8-13-11/h6,12-13H,4-5,7-9H2,1-3H3 |
| InChIKey | BQMOATQKRFIUGU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(5,6-dimethyl-2,3-dihydro-1H-pyridin-6-yl)methyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5,6-dimethyl-2,3-dihydro-1H-pyridin-6-yl)methyl]propan-1-amine?
The IUPAC name of N-[(5,6-dimethyl-2,3-dihydro-1H-pyridin-6-yl)methyl]propan-1-amine (CID 142227131) is N-[(5,6-dimethyl-2,3-dihydro-1H-pyridin-6-yl)methyl]propan-1-amine.
What is the SMILES notation for N-[(5,6-dimethyl-2,3-dihydro-1H-pyridin-6-yl)methyl]propan-1-amine?
The canonical SMILES for N-[(5,6-dimethyl-2,3-dihydro-1H-pyridin-6-yl)methyl]propan-1-amine is CCCNCC1(C)NCCC=C1C.
What is the InChIKey of N-[(5,6-dimethyl-2,3-dihydro-1H-pyridin-6-yl)methyl]propan-1-amine?
The InChIKey is BQMOATQKRFIUGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2/c1-4-7-12-9-11(3)10(2)6-5-8-13-11/h6,12-13H,4-5,7-9H2,1-3H3.
What are the key properties of N-[(5,6-dimethyl-2,3-dihydro-1H-pyridin-6-yl)methyl]propan-1-amine?
N-[(5,6-dimethyl-2,3-dihydro-1H-pyridin-6-yl)methyl]propan-1-amine has a molecular weight of 182.31 g/mol, XLogP of 1.68, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5,6-dimethyl-2,3-dihydro-1H-pyridin-6-yl)methyl]propan-1-amine is sourced from PubChem (CID 142227131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).