C15H27NO2 — CID 142227195
O-[(E)-3-methyl-5-[(1S)-1,3,3-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]pent-2-enyl]hydroxylamine (PubChem CID 142227195) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is O-[(E)-3-methyl-5-[(1S)-1,3,3-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]pent-2-enyl]hydroxylamine.
| Compound Name | O-[(E)-3-methyl-5-[(1S)-1,3,3-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]pent-2-enyl]hydroxylamine |
|---|---|
| PubChem CID | 142227195 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | O-[(E)-3-methyl-5-[(1S)-1,3,3-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]pent-2-enyl]hydroxylamine |
| SMILES | C/C(=C\CON)CCC1C(C)(C)C2CC[C@]1(C)O2 |
| InChI | InChI=1S/C15H27NO2/c1-11(8-10-17-16)5-6-12-14(2,3)13-7-9-15(12,4)18-13/h8,12-13H,5-7,9-10,16H2,1-4H3/b11-8+/t12?,13?,15-/m0/s1 |
| InChIKey | WHVUQBINUOXYIV-IYPXIDLGSA-N |
| XLogP | 3.20 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|