About 4-tert-butylpyrido[4,3-h][1,3]benzoxazin-2-one;ethane
4-tert-butylpyrido[4,3-h][1,3]benzoxazin-2-one;ethane (PubChem CID 142227335) has the molecular formula C17H20N2O2
and a molecular weight of 284.36 g/mol. Its IUPAC name is 4-tert-butylpyrido[4,3-h][1,3]benzoxazin-2-one;ethane.
Molecular Properties
| Compound Name | 4-tert-butylpyrido[4,3-h][1,3]benzoxazin-2-one;ethane |
| PubChem CID | 142227335 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 4-tert-butylpyrido[4,3-h][1,3]benzoxazin-2-one;ethane |
| SMILES | CC.CC(C)(C)c1nc(=O)oc2c1ccc1ccncc12 |
| InChI | InChI=1S/C15H14N2O2.C2H6/c1-15(2,3)13-10-5-4-9-6-7-16-8-11(9)12(10)19-14(18)17-13;1-2/h4-8H,1-3H3;1-2H3 |
| InChIKey | KKFSJKVGXBHNIP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butylpyrido[4,3-h][1,3]benzoxazin-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butylpyrido[4,3-h][1,3]benzoxazin-2-one;ethane?
The IUPAC name of 4-tert-butylpyrido[4,3-h][1,3]benzoxazin-2-one;ethane (CID 142227335) is 4-tert-butylpyrido[4,3-h][1,3]benzoxazin-2-one;ethane.
What is the SMILES notation for 4-tert-butylpyrido[4,3-h][1,3]benzoxazin-2-one;ethane?
The canonical SMILES for 4-tert-butylpyrido[4,3-h][1,3]benzoxazin-2-one;ethane is CC.CC(C)(C)c1nc(=O)oc2c1ccc1ccncc12.
What is the InChIKey of 4-tert-butylpyrido[4,3-h][1,3]benzoxazin-2-one;ethane?
The InChIKey is KKFSJKVGXBHNIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O2.C2H6/c1-15(2,3)13-10-5-4-9-6-7-16-8-11(9)12(10)19-14(18)17-13;1-2/h4-8H,1-3H3;1-2H3.
What are the key properties of 4-tert-butylpyrido[4,3-h][1,3]benzoxazin-2-one;ethane?
4-tert-butylpyrido[4,3-h][1,3]benzoxazin-2-one;ethane has a molecular weight of 284.36 g/mol, XLogP of 4.06, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butylpyrido[4,3-h][1,3]benzoxazin-2-one;ethane is sourced from PubChem (CID 142227335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).