About ethane;2-[2-(2-methylhydrazinyl)butylsulfinylmethyl]benzonitrile;propanal
ethane;2-[2-(2-methylhydrazinyl)butylsulfinylmethyl]benzonitrile;propanal (PubChem CID 142227488) has the molecular formula C18H31N3O2S
and a molecular weight of 353.53 g/mol. Its IUPAC name is ethane;2-[2-(2-methylhydrazinyl)butylsulfinylmethyl]benzonitrile;propanal.
Molecular Properties
| Compound Name | ethane;2-[2-(2-methylhydrazinyl)butylsulfinylmethyl]benzonitrile;propanal |
| PubChem CID | 142227488 |
| Molecular Formula | C18H31N3O2S |
| Molecular Weight | 353.53 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | ethane;2-[2-(2-methylhydrazinyl)butylsulfinylmethyl]benzonitrile;propanal |
| SMILES | CC.CCC(CS(=O)Cc1ccccc1C#N)NNC.CCC=O |
| InChI | InChI=1S/C13H19N3OS.C3H6O.C2H6/c1-3-13(16-15-2)10-18(17)9-12-7-5-4-6-11(12)8-14;1-2-3-4;1-2/h4-7,13,15-16H,3,9-10H2,1-2H3;3H,2H2,1H3;1-2H3 |
| InChIKey | PFBVPMDMZHTCCN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.53 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-[2-(2-methylhydrazinyl)butylsulfinylmethyl]benzonitrile;propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-[2-(2-methylhydrazinyl)butylsulfinylmethyl]benzonitrile;propanal?
The IUPAC name of ethane;2-[2-(2-methylhydrazinyl)butylsulfinylmethyl]benzonitrile;propanal (CID 142227488) is ethane;2-[2-(2-methylhydrazinyl)butylsulfinylmethyl]benzonitrile;propanal.
What is the SMILES notation for ethane;2-[2-(2-methylhydrazinyl)butylsulfinylmethyl]benzonitrile;propanal?
The canonical SMILES for ethane;2-[2-(2-methylhydrazinyl)butylsulfinylmethyl]benzonitrile;propanal is CC.CCC(CS(=O)Cc1ccccc1C#N)NNC.CCC=O.
What is the InChIKey of ethane;2-[2-(2-methylhydrazinyl)butylsulfinylmethyl]benzonitrile;propanal?
The InChIKey is PFBVPMDMZHTCCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3OS.C3H6O.C2H6/c1-3-13(16-15-2)10-18(17)9-12-7-5-4-6-11(12)8-14;1-2-3-4;1-2/h4-7,13,15-16H,3,9-10H2,1-2H3;3H,2H2,1H3;1-2H3.
What are the key properties of ethane;2-[2-(2-methylhydrazinyl)butylsulfinylmethyl]benzonitrile;propanal?
ethane;2-[2-(2-methylhydrazinyl)butylsulfinylmethyl]benzonitrile;propanal has a molecular weight of 353.53 g/mol, XLogP of 2.93, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-[2-(2-methylhydrazinyl)butylsulfinylmethyl]benzonitrile;propanal is sourced from PubChem (CID 142227488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).