About 3-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(methylamino)butanenitrile
3-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(methylamino)butanenitrile (PubChem CID 142227664) has the molecular formula C12H18N2O
and a molecular weight of 206.29 g/mol. Its IUPAC name is 3-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(methylamino)butanenitrile.
Molecular Properties
| Compound Name | 3-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(methylamino)butanenitrile |
| PubChem CID | 142227664 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 3-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(methylamino)butanenitrile |
| SMILES | C=C/C=C(\C=C)COC(C)C(C#N)NC |
| InChI | InChI=1S/C12H18N2O/c1-5-7-11(6-2)9-15-10(3)12(8-13)14-4/h5-7,10,12,14H,1-2,9H2,3-4H3/b11-7+ |
| InChIKey | KMVCNCUAMNMZFZ-YRNVUSSQSA-N |
| XLogP | 1.80 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(methylamino)butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(methylamino)butanenitrile?
The IUPAC name of 3-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(methylamino)butanenitrile (CID 142227664) is 3-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(methylamino)butanenitrile.
What is the SMILES notation for 3-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(methylamino)butanenitrile?
The canonical SMILES for 3-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(methylamino)butanenitrile is C=C/C=C(\C=C)COC(C)C(C#N)NC.
What is the InChIKey of 3-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(methylamino)butanenitrile?
The InChIKey is KMVCNCUAMNMZFZ-YRNVUSSQSA-N. The full InChI is InChI=1S/C12H18N2O/c1-5-7-11(6-2)9-15-10(3)12(8-13)14-4/h5-7,10,12,14H,1-2,9H2,3-4H3/b11-7+.
What are the key properties of 3-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(methylamino)butanenitrile?
3-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(methylamino)butanenitrile has a molecular weight of 206.29 g/mol, XLogP of 1.80, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2E)-2-ethenylpenta-2,4-dienoxy]-2-(methylamino)butanenitrile is sourced from PubChem (CID 142227664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).