C17H31F4NO — CID 142227834
2-amino-1-(1,1,2,2-tetrafluorospiro[2.5]octan-6-yl)pentan-3-one;ethane (PubChem CID 142227834) has the molecular formula C17H31F4NO and a molecular weight of 341.43 g/mol. Its IUPAC name is 2-amino-1-(1,1,2,2-tetrafluorospiro[2.5]octan-6-yl)pentan-3-one;ethane.
| Compound Name | 2-amino-1-(1,1,2,2-tetrafluorospiro[2.5]octan-6-yl)pentan-3-one;ethane |
|---|---|
| PubChem CID | 142227834 |
| Molecular Formula | C17H31F4NO |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.23 |
| IUPAC Name | 2-amino-1-(1,1,2,2-tetrafluorospiro[2.5]octan-6-yl)pentan-3-one;ethane |
| SMILES | CC.CC.CCC(=O)C(N)CC1CCC2(CC1)C(F)(F)C2(F)F |
| InChI | InChI=1S/C13H19F4NO.2C2H6/c1-2-10(19)9(18)7-8-3-5-11(6-4-8)12(14,15)13(11,16)17;2*1-2/h8-9H,2-7,18H2,1H3;2*1-2H3 |
| InChIKey | UTUSHQFTVMRVNU-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|