About 2-amino-3-[(2E)-2-ethenylpenta-2,4-dienoxy]propanenitrile
2-amino-3-[(2E)-2-ethenylpenta-2,4-dienoxy]propanenitrile (PubChem CID 142227853) has the molecular formula C10H14N2O
and a molecular weight of 178.23 g/mol. Its IUPAC name is 2-amino-3-[(2E)-2-ethenylpenta-2,4-dienoxy]propanenitrile.
Molecular Properties
| Compound Name | 2-amino-3-[(2E)-2-ethenylpenta-2,4-dienoxy]propanenitrile |
| PubChem CID | 142227853 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 2-amino-3-[(2E)-2-ethenylpenta-2,4-dienoxy]propanenitrile |
| SMILES | C=C/C=C(\C=C)COCC(N)C#N |
| InChI | InChI=1S/C10H14N2O/c1-3-5-9(4-2)7-13-8-10(12)6-11/h3-5,10H,1-2,7-8,12H2/b9-5+ |
| InChIKey | MFFAWUAITFDYBS-WEVVVXLNSA-N |
| XLogP | 1.15 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-[(2E)-2-ethenylpenta-2,4-dienoxy]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-[(2E)-2-ethenylpenta-2,4-dienoxy]propanenitrile?
The IUPAC name of 2-amino-3-[(2E)-2-ethenylpenta-2,4-dienoxy]propanenitrile (CID 142227853) is 2-amino-3-[(2E)-2-ethenylpenta-2,4-dienoxy]propanenitrile.
What is the SMILES notation for 2-amino-3-[(2E)-2-ethenylpenta-2,4-dienoxy]propanenitrile?
The canonical SMILES for 2-amino-3-[(2E)-2-ethenylpenta-2,4-dienoxy]propanenitrile is C=C/C=C(\C=C)COCC(N)C#N.
What is the InChIKey of 2-amino-3-[(2E)-2-ethenylpenta-2,4-dienoxy]propanenitrile?
The InChIKey is MFFAWUAITFDYBS-WEVVVXLNSA-N. The full InChI is InChI=1S/C10H14N2O/c1-3-5-9(4-2)7-13-8-10(12)6-11/h3-5,10H,1-2,7-8,12H2/b9-5+.
What are the key properties of 2-amino-3-[(2E)-2-ethenylpenta-2,4-dienoxy]propanenitrile?
2-amino-3-[(2E)-2-ethenylpenta-2,4-dienoxy]propanenitrile has a molecular weight of 178.23 g/mol, XLogP of 1.15, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[(2E)-2-ethenylpenta-2,4-dienoxy]propanenitrile is sourced from PubChem (CID 142227853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).