About 2-amino-4,4-dimethyl-1-propan-2-yloxyhexan-3-one;ethane
2-amino-4,4-dimethyl-1-propan-2-yloxyhexan-3-one;ethane (PubChem CID 142227971) has the molecular formula C13H29NO2
and a molecular weight of 231.38 g/mol. Its IUPAC name is 2-amino-4,4-dimethyl-1-propan-2-yloxyhexan-3-one;ethane.
Molecular Properties
| Compound Name | 2-amino-4,4-dimethyl-1-propan-2-yloxyhexan-3-one;ethane |
| PubChem CID | 142227971 |
| Molecular Formula | C13H29NO2 |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.22 |
| IUPAC Name | 2-amino-4,4-dimethyl-1-propan-2-yloxyhexan-3-one;ethane |
| SMILES | CC.CCC(C)(C)C(=O)C(N)COC(C)C |
| InChI | InChI=1S/C11H23NO2.C2H6/c1-6-11(4,5)10(13)9(12)7-14-8(2)3;1-2/h8-9H,6-7,12H2,1-5H3;1-2H3 |
| InChIKey | YEBBBSQJDHXSIT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-4,4-dimethyl-1-propan-2-yloxyhexan-3-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4,4-dimethyl-1-propan-2-yloxyhexan-3-one;ethane?
The IUPAC name of 2-amino-4,4-dimethyl-1-propan-2-yloxyhexan-3-one;ethane (CID 142227971) is 2-amino-4,4-dimethyl-1-propan-2-yloxyhexan-3-one;ethane.
What is the SMILES notation for 2-amino-4,4-dimethyl-1-propan-2-yloxyhexan-3-one;ethane?
The canonical SMILES for 2-amino-4,4-dimethyl-1-propan-2-yloxyhexan-3-one;ethane is CC.CCC(C)(C)C(=O)C(N)COC(C)C.
What is the InChIKey of 2-amino-4,4-dimethyl-1-propan-2-yloxyhexan-3-one;ethane?
The InChIKey is YEBBBSQJDHXSIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO2.C2H6/c1-6-11(4,5)10(13)9(12)7-14-8(2)3;1-2/h8-9H,6-7,12H2,1-5H3;1-2H3.
What are the key properties of 2-amino-4,4-dimethyl-1-propan-2-yloxyhexan-3-one;ethane?
2-amino-4,4-dimethyl-1-propan-2-yloxyhexan-3-one;ethane has a molecular weight of 231.38 g/mol, XLogP of 2.77, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4,4-dimethyl-1-propan-2-yloxyhexan-3-one;ethane is sourced from PubChem (CID 142227971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).