1-aminocyclopentane-1-carbonitrile;ethane;molecular hydrogen

C8H18N2 — CID 142228148

IUPAC1-aminocyclopentane-1-carbonitrile;ethane;molecular hydrogen
SMILESCC.N#CC1(N)CCCC1.[H][H]
InChIInChI=1S/C6H10N2.C2H6.H2/c7-5-6(8)3-1-2-4-6;1-2;/h1-4,8H2;1-2H3;1H
InChIKeyRUKCFBPPQYMLCW-UHFFFAOYSA-N
MW142.25 g/mol
LogP2.05
Rot. Bonds

About 1-aminocyclopentane-1-carbonitrile;ethane;molecular hydrogen

1-aminocyclopentane-1-carbonitrile;ethane;molecular hydrogen (PubChem CID 142228148) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is 1-aminocyclopentane-1-carbonitrile;ethane;molecular hydrogen.

Molecular Properties

Compound Name1-aminocyclopentane-1-carbonitrile;ethane;molecular hydrogen
PubChem CID142228148
Molecular FormulaC8H18N2
Molecular Weight142.25 g/mol
Exact Mass142.15
IUPAC Name1-aminocyclopentane-1-carbonitrile;ethane;molecular hydrogen
SMILESCC.N#CC1(N)CCCC1.[H][H]
InChIInChI=1S/C6H10N2.C2H6.H2/c7-5-6(8)3-1-2-4-6;1-2;/h1-4,8H2;1-2H3;1H
InChIKeyRUKCFBPPQYMLCW-UHFFFAOYSA-N
XLogP2.05
TPSA49.81 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500142.25
LogP ≤ 52.05
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 1-aminocyclopentane-1-carbonitrile;ethane;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-aminocyclopentane-1-carbonitrile;ethane;molecular hydrogen?
The IUPAC name of 1-aminocyclopentane-1-carbonitrile;ethane;molecular hydrogen (CID 142228148) is 1-aminocyclopentane-1-carbonitrile;ethane;molecular hydrogen.
What is the SMILES notation for 1-aminocyclopentane-1-carbonitrile;ethane;molecular hydrogen?
The canonical SMILES for 1-aminocyclopentane-1-carbonitrile;ethane;molecular hydrogen is CC.N#CC1(N)CCCC1.[H][H].
What is the InChIKey of 1-aminocyclopentane-1-carbonitrile;ethane;molecular hydrogen?
The InChIKey is RUKCFBPPQYMLCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2.C2H6.H2/c7-5-6(8)3-1-2-4-6;1-2;/h1-4,8H2;1-2H3;1H.
What are the key properties of 1-aminocyclopentane-1-carbonitrile;ethane;molecular hydrogen?
1-aminocyclopentane-1-carbonitrile;ethane;molecular hydrogen has a molecular weight of 142.25 g/mol, XLogP of 2.05, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminocyclopentane-1-carbonitrile;ethane;molecular hydrogen is sourced from PubChem (CID 142228148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).