About 1-aminocyclopentane-1-carbonitrile;ethane;molecular hydrogen
1-aminocyclopentane-1-carbonitrile;ethane;molecular hydrogen (PubChem CID 142228148) has the molecular formula C8H18N2
and a molecular weight of 142.25 g/mol. Its IUPAC name is 1-aminocyclopentane-1-carbonitrile;ethane;molecular hydrogen.
Molecular Properties
| Compound Name | 1-aminocyclopentane-1-carbonitrile;ethane;molecular hydrogen |
| PubChem CID | 142228148 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | 1-aminocyclopentane-1-carbonitrile;ethane;molecular hydrogen |
| SMILES | CC.N#CC1(N)CCCC1.[H][H] |
| InChI | InChI=1S/C6H10N2.C2H6.H2/c7-5-6(8)3-1-2-4-6;1-2;/h1-4,8H2;1-2H3;1H |
| InChIKey | RUKCFBPPQYMLCW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-aminocyclopentane-1-carbonitrile;ethane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminocyclopentane-1-carbonitrile;ethane;molecular hydrogen?
The IUPAC name of 1-aminocyclopentane-1-carbonitrile;ethane;molecular hydrogen (CID 142228148) is 1-aminocyclopentane-1-carbonitrile;ethane;molecular hydrogen.
What is the SMILES notation for 1-aminocyclopentane-1-carbonitrile;ethane;molecular hydrogen?
The canonical SMILES for 1-aminocyclopentane-1-carbonitrile;ethane;molecular hydrogen is CC.N#CC1(N)CCCC1.[H][H].
What is the InChIKey of 1-aminocyclopentane-1-carbonitrile;ethane;molecular hydrogen?
The InChIKey is RUKCFBPPQYMLCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2.C2H6.H2/c7-5-6(8)3-1-2-4-6;1-2;/h1-4,8H2;1-2H3;1H.
What are the key properties of 1-aminocyclopentane-1-carbonitrile;ethane;molecular hydrogen?
1-aminocyclopentane-1-carbonitrile;ethane;molecular hydrogen has a molecular weight of 142.25 g/mol, XLogP of 2.05, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminocyclopentane-1-carbonitrile;ethane;molecular hydrogen is sourced from PubChem (CID 142228148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).