C14H30N2 — CID 142229086
4-N-[(2R)-2-ethyl-3-methylpentyl]cyclohexane-1,4-diamine (PubChem CID 142229086) has the molecular formula C14H30N2 and a molecular weight of 226.41 g/mol. Its IUPAC name is 4-N-[(2R)-2-ethyl-3-methylpentyl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-[(2R)-2-ethyl-3-methylpentyl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 142229086 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | 4-N-[(2R)-2-ethyl-3-methylpentyl]cyclohexane-1,4-diamine |
| SMILES | CCC(C)C(CC)CNC1CCC(N)CC1 |
| InChI | InChI=1S/C14H30N2/c1-4-11(3)12(5-2)10-16-14-8-6-13(15)7-9-14/h11-14,16H,4-10,15H2,1-3H3 |
| InChIKey | PDWMOKPJBPMUAG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |