About 2,4-dimethoxy-5-oxo-7,8-dihydro-6H-quinazoline-6-carbonitrile
2,4-dimethoxy-5-oxo-7,8-dihydro-6H-quinazoline-6-carbonitrile (PubChem CID 14222969) has the molecular formula C11H11N3O3
and a molecular weight of 233.23 g/mol. Its IUPAC name is 2,4-dimethoxy-5-oxo-7,8-dihydro-6H-quinazoline-6-carbonitrile.
Molecular Properties
| Compound Name | 2,4-dimethoxy-5-oxo-7,8-dihydro-6H-quinazoline-6-carbonitrile |
| PubChem CID | 14222969 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 2,4-dimethoxy-5-oxo-7,8-dihydro-6H-quinazoline-6-carbonitrile |
| SMILES | COc1nc2c(c(OC)n1)C(=O)C(C#N)CC2 |
| InChI | InChI=1S/C11H11N3O3/c1-16-10-8-7(13-11(14-10)17-2)4-3-6(5-12)9(8)15/h6H,3-4H2,1-2H3 |
| InChIKey | OGVYIJFCMUGKET-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 85.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethoxy-5-oxo-7,8-dihydro-6H-quinazoline-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethoxy-5-oxo-7,8-dihydro-6H-quinazoline-6-carbonitrile?
The IUPAC name of 2,4-dimethoxy-5-oxo-7,8-dihydro-6H-quinazoline-6-carbonitrile (CID 14222969) is 2,4-dimethoxy-5-oxo-7,8-dihydro-6H-quinazoline-6-carbonitrile.
What is the SMILES notation for 2,4-dimethoxy-5-oxo-7,8-dihydro-6H-quinazoline-6-carbonitrile?
The canonical SMILES for 2,4-dimethoxy-5-oxo-7,8-dihydro-6H-quinazoline-6-carbonitrile is COc1nc2c(c(OC)n1)C(=O)C(C#N)CC2.
What is the InChIKey of 2,4-dimethoxy-5-oxo-7,8-dihydro-6H-quinazoline-6-carbonitrile?
The InChIKey is OGVYIJFCMUGKET-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O3/c1-16-10-8-7(13-11(14-10)17-2)4-3-6(5-12)9(8)15/h6H,3-4H2,1-2H3.
What are the key properties of 2,4-dimethoxy-5-oxo-7,8-dihydro-6H-quinazoline-6-carbonitrile?
2,4-dimethoxy-5-oxo-7,8-dihydro-6H-quinazoline-6-carbonitrile has a molecular weight of 233.23 g/mol, XLogP of 0.76, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethoxy-5-oxo-7,8-dihydro-6H-quinazoline-6-carbonitrile is sourced from PubChem (CID 14222969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).