C25H33N6O4S+ — CID 142229870
[4-[[4-[[[4-(dimethylamino)quinazolin-2-yl]amino]methyl]cyclohexyl]methylsulfamoyl]phenyl]-methoxy-oxoazanium (PubChem CID 142229870) has the molecular formula C25H33N6O4S+ and a molecular weight of 513.64 g/mol. Its IUPAC name is [4-[[4-[[[4-(dimethylamino)quinazolin-2-yl]amino]methyl]cyclohexyl]methylsulfamoyl]phenyl]-methoxy-oxoazanium.
| Compound Name | [4-[[4-[[[4-(dimethylamino)quinazolin-2-yl]amino]methyl]cyclohexyl]methylsulfamoyl]phenyl]-methoxy-oxoazanium |
|---|---|
| PubChem CID | 142229870 |
| Molecular Formula | C25H33N6O4S+ |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | [4-[[4-[[[4-(dimethylamino)quinazolin-2-yl]amino]methyl]cyclohexyl]methylsulfamoyl]phenyl]-methoxy-oxoazanium |
| SMILES | CO[N+](=O)c1ccc(S(=O)(=O)NCC2CCC(CNc3nc(N(C)C)c4ccccc4n3)CC2)cc1 |
| InChI | InChI=1S/C25H33N6O4S/c1-30(2)24-22-6-4-5-7-23(22)28-25(29-24)26-16-18-8-10-19(11-9-18)17-27-36(33,34)21-14-12-20(13-15-21)31(32)35-3/h4-7,12-15,18-19,27H,8-11,16-17H2,1-3H3,(H,26,28,29)/q+1 |
| InChIKey | QGFXGKAGUBHJRU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|