About 5-ethylsulfinyl-2,4-dimethylpyridazin-3-one
5-ethylsulfinyl-2,4-dimethylpyridazin-3-one (PubChem CID 14223004) has the molecular formula C8H12N2O2S
and a molecular weight of 200.26 g/mol. Its IUPAC name is 5-ethylsulfinyl-2,4-dimethylpyridazin-3-one.
Molecular Properties
| Compound Name | 5-ethylsulfinyl-2,4-dimethylpyridazin-3-one |
| PubChem CID | 14223004 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 5-ethylsulfinyl-2,4-dimethylpyridazin-3-one |
| SMILES | CCS(=O)c1cnn(C)c(=O)c1C |
| InChI | InChI=1S/C8H12N2O2S/c1-4-13(12)7-5-9-10(3)8(11)6(7)2/h5H,4H2,1-3H3 |
| InChIKey | CENAJPBDOBYAHI-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-ethylsulfinyl-2,4-dimethylpyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylsulfinyl-2,4-dimethylpyridazin-3-one?
The IUPAC name of 5-ethylsulfinyl-2,4-dimethylpyridazin-3-one (CID 14223004) is 5-ethylsulfinyl-2,4-dimethylpyridazin-3-one.
What is the SMILES notation for 5-ethylsulfinyl-2,4-dimethylpyridazin-3-one?
The canonical SMILES for 5-ethylsulfinyl-2,4-dimethylpyridazin-3-one is CCS(=O)c1cnn(C)c(=O)c1C.
What is the InChIKey of 5-ethylsulfinyl-2,4-dimethylpyridazin-3-one?
The InChIKey is CENAJPBDOBYAHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2S/c1-4-13(12)7-5-9-10(3)8(11)6(7)2/h5H,4H2,1-3H3.
What are the key properties of 5-ethylsulfinyl-2,4-dimethylpyridazin-3-one?
5-ethylsulfinyl-2,4-dimethylpyridazin-3-one has a molecular weight of 200.26 g/mol, XLogP of 0.22, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylsulfinyl-2,4-dimethylpyridazin-3-one is sourced from PubChem (CID 14223004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).