About 2-[2-[[(4-ethylcyclohexyl)methylamino]methyl]cyclohexa-1,3-dien-1-yl]oxyethanol
2-[2-[[(4-ethylcyclohexyl)methylamino]methyl]cyclohexa-1,3-dien-1-yl]oxyethanol (PubChem CID 142230429) has the molecular formula C18H31NO2
and a molecular weight of 293.45 g/mol. Its IUPAC name is 2-[2-[[(4-ethylcyclohexyl)methylamino]methyl]cyclohexa-1,3-dien-1-yl]oxyethanol.
Molecular Properties
| Compound Name | 2-[2-[[(4-ethylcyclohexyl)methylamino]methyl]cyclohexa-1,3-dien-1-yl]oxyethanol |
| PubChem CID | 142230429 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | 2-[2-[[(4-ethylcyclohexyl)methylamino]methyl]cyclohexa-1,3-dien-1-yl]oxyethanol |
| SMILES | CCC1CCC(CNCC2=C(OCCO)CCC=C2)CC1 |
| InChI | InChI=1S/C18H31NO2/c1-2-15-7-9-16(10-8-15)13-19-14-17-5-3-4-6-18(17)21-12-11-20/h3,5,15-16,19-20H,2,4,6-14H2,1H3 |
| InChIKey | XNFVQECUIKAZIV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-[[(4-ethylcyclohexyl)methylamino]methyl]cyclohexa-1,3-dien-1-yl]oxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[[(4-ethylcyclohexyl)methylamino]methyl]cyclohexa-1,3-dien-1-yl]oxyethanol?
The IUPAC name of 2-[2-[[(4-ethylcyclohexyl)methylamino]methyl]cyclohexa-1,3-dien-1-yl]oxyethanol (CID 142230429) is 2-[2-[[(4-ethylcyclohexyl)methylamino]methyl]cyclohexa-1,3-dien-1-yl]oxyethanol.
What is the SMILES notation for 2-[2-[[(4-ethylcyclohexyl)methylamino]methyl]cyclohexa-1,3-dien-1-yl]oxyethanol?
The canonical SMILES for 2-[2-[[(4-ethylcyclohexyl)methylamino]methyl]cyclohexa-1,3-dien-1-yl]oxyethanol is CCC1CCC(CNCC2=C(OCCO)CCC=C2)CC1.
What is the InChIKey of 2-[2-[[(4-ethylcyclohexyl)methylamino]methyl]cyclohexa-1,3-dien-1-yl]oxyethanol?
The InChIKey is XNFVQECUIKAZIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31NO2/c1-2-15-7-9-16(10-8-15)13-19-14-17-5-3-4-6-18(17)21-12-11-20/h3,5,15-16,19-20H,2,4,6-14H2,1H3.
What are the key properties of 2-[2-[[(4-ethylcyclohexyl)methylamino]methyl]cyclohexa-1,3-dien-1-yl]oxyethanol?
2-[2-[[(4-ethylcyclohexyl)methylamino]methyl]cyclohexa-1,3-dien-1-yl]oxyethanol has a molecular weight of 293.45 g/mol, XLogP of 3.41, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[[(4-ethylcyclohexyl)methylamino]methyl]cyclohexa-1,3-dien-1-yl]oxyethanol is sourced from PubChem (CID 142230429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).