C8H8N2O2 — CID 142230569
1-(1,7a-dihydro-2,1,3-benzoxadiazol-5-yl)ethanone (PubChem CID 142230569) has the molecular formula C8H8N2O2 and a molecular weight of 164.16 g/mol. Its IUPAC name is 1-(1,7a-dihydro-2,1,3-benzoxadiazol-5-yl)ethanone.
| Compound Name | 1-(1,7a-dihydro-2,1,3-benzoxadiazol-5-yl)ethanone |
|---|---|
| PubChem CID | 142230569 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 1-(1,7a-dihydro-2,1,3-benzoxadiazol-5-yl)ethanone |
| SMILES | CC(=O)C1=CC2=NONC2C=C1 |
| InChI | InChI=1S/C8H8N2O2/c1-5(11)6-2-3-7-8(4-6)10-12-9-7/h2-4,7,9H,1H3 |
| InChIKey | VLQUEBWNVPSYLR-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |