C33H46FN5 — CID 142231270
2-N-[4-[3-[2-(4-cyclohex-2-en-1-yl-3-fluorocyclohexa-2,4-dien-1-yl)propyl]aziridin-2-yl]cyclohexyl]-4-N,4-N-dimethyl-6,7-dihydroquinazoline-2,4-diamine (PubChem CID 142231270) has the molecular formula C33H46FN5 and a molecular weight of 531.76 g/mol. Its IUPAC name is 2-N-[4-[3-[2-(4-cyclohex-2-en-1-yl-3-fluorocyclohexa-2,4-dien-1-yl)propyl]aziridin-2-yl]cyclohexyl]-4-N,4-N-dimethyl-6,7-dihydroquinazoline-2,4-diamine.
| Compound Name | 2-N-[4-[3-[2-(4-cyclohex-2-en-1-yl-3-fluorocyclohexa-2,4-dien-1-yl)propyl]aziridin-2-yl]cyclohexyl]-4-N,4-N-dimethyl-6,7-dihydroquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 142231270 |
| Molecular Formula | C33H46FN5 |
| Molecular Weight | 531.76 g/mol |
| Exact Mass | 531.37 |
| IUPAC Name | 2-N-[4-[3-[2-(4-cyclohex-2-en-1-yl-3-fluorocyclohexa-2,4-dien-1-yl)propyl]aziridin-2-yl]cyclohexyl]-4-N,4-N-dimethyl-6,7-dihydroquinazoline-2,4-diamine |
| SMILES | CC(CC1NC1C1CCC(Nc2nc(N(C)C)c3c(n2)=CCCC=3)CC1)C1C=C(F)C(C2C=CCCC2)=CC1 |
| InChI | InChI=1S/C33H46FN5/c1-21(24-15-18-26(28(34)20-24)22-9-5-4-6-10-22)19-30-31(36-30)23-13-16-25(17-14-23)35-33-37-29-12-8-7-11-27(29)32(38-33)39(2)3/h5,9,11-12,18,20-25,30-31,36H,4,6-8,10,13-17,19H2,1-3H3,(H,35,37) |
| InChIKey | UKWNMGSKLFHSIC-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 62.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.76 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|