C29H42N2O2 — CID 142231315
ethane;2-[2-[(4-ethylcyclohexyl)methylamino]-2-oxoethyl]-N-(4-propan-2-ylphenyl)benzamide (PubChem CID 142231315) has the molecular formula C29H42N2O2 and a molecular weight of 450.67 g/mol. Its IUPAC name is ethane;2-[2-[(4-ethylcyclohexyl)methylamino]-2-oxoethyl]-N-(4-propan-2-ylphenyl)benzamide.
| Compound Name | ethane;2-[2-[(4-ethylcyclohexyl)methylamino]-2-oxoethyl]-N-(4-propan-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 142231315 |
| Molecular Formula | C29H42N2O2 |
| Molecular Weight | 450.67 g/mol |
| Exact Mass | 450.32 |
| IUPAC Name | ethane;2-[2-[(4-ethylcyclohexyl)methylamino]-2-oxoethyl]-N-(4-propan-2-ylphenyl)benzamide |
| SMILES | CC.CCC1CCC(CNC(=O)Cc2ccccc2C(=O)Nc2ccc(C(C)C)cc2)CC1 |
| InChI | InChI=1S/C27H36N2O2.C2H6/c1-4-20-9-11-21(12-10-20)18-28-26(30)17-23-7-5-6-8-25(23)27(31)29-24-15-13-22(14-16-24)19(2)3;1-2/h5-8,13-16,19-21H,4,9-12,17-18H2,1-3H3,(H,28,30)(H,29,31);1-2H3 |
| InChIKey | CTQYRFGHVFLEOY-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.67 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |