About methane;2-[4-[methyl(propyl)carbamoyl]piperidin-1-yl]acetic acid
methane;2-[4-[methyl(propyl)carbamoyl]piperidin-1-yl]acetic acid (PubChem CID 142231672) has the molecular formula C13H26N2O3
and a molecular weight of 258.36 g/mol. Its IUPAC name is methane;2-[4-[methyl(propyl)carbamoyl]piperidin-1-yl]acetic acid.
Molecular Properties
| Compound Name | methane;2-[4-[methyl(propyl)carbamoyl]piperidin-1-yl]acetic acid |
| PubChem CID | 142231672 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | methane;2-[4-[methyl(propyl)carbamoyl]piperidin-1-yl]acetic acid |
| SMILES | C.CCCN(C)C(=O)C1CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C12H22N2O3.CH4/c1-3-6-13(2)12(17)10-4-7-14(8-5-10)9-11(15)16;/h10H,3-9H2,1-2H3,(H,15,16);1H4 |
| InChIKey | KGPSIXHIDAEYHW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methane;2-[4-[methyl(propyl)carbamoyl]piperidin-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-[4-[methyl(propyl)carbamoyl]piperidin-1-yl]acetic acid?
The IUPAC name of methane;2-[4-[methyl(propyl)carbamoyl]piperidin-1-yl]acetic acid (CID 142231672) is methane;2-[4-[methyl(propyl)carbamoyl]piperidin-1-yl]acetic acid.
What is the SMILES notation for methane;2-[4-[methyl(propyl)carbamoyl]piperidin-1-yl]acetic acid?
The canonical SMILES for methane;2-[4-[methyl(propyl)carbamoyl]piperidin-1-yl]acetic acid is C.CCCN(C)C(=O)C1CCN(CC(=O)O)CC1.
What is the InChIKey of methane;2-[4-[methyl(propyl)carbamoyl]piperidin-1-yl]acetic acid?
The InChIKey is KGPSIXHIDAEYHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O3.CH4/c1-3-6-13(2)12(17)10-4-7-14(8-5-10)9-11(15)16;/h10H,3-9H2,1-2H3,(H,15,16);1H4.
What are the key properties of methane;2-[4-[methyl(propyl)carbamoyl]piperidin-1-yl]acetic acid?
methane;2-[4-[methyl(propyl)carbamoyl]piperidin-1-yl]acetic acid has a molecular weight of 258.36 g/mol, XLogP of 1.29, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-[4-[methyl(propyl)carbamoyl]piperidin-1-yl]acetic acid is sourced from PubChem (CID 142231672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).