C13H20N6O — CID 142231842
N-(2-aminoethyl)-6-imidazol-1-yl-N-methylpyridine-3-carboxamide;methanamine (PubChem CID 142231842) has the molecular formula C13H20N6O and a molecular weight of 276.34 g/mol. Its IUPAC name is N-(2-aminoethyl)-6-imidazol-1-yl-N-methylpyridine-3-carboxamide;methanamine.
| Compound Name | N-(2-aminoethyl)-6-imidazol-1-yl-N-methylpyridine-3-carboxamide;methanamine |
|---|---|
| PubChem CID | 142231842 |
| Molecular Formula | C13H20N6O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | N-(2-aminoethyl)-6-imidazol-1-yl-N-methylpyridine-3-carboxamide;methanamine |
| SMILES | CN.CN(CCN)C(=O)c1ccc(-n2ccnc2)nc1 |
| InChI | InChI=1S/C12H15N5O.CH5N/c1-16(6-4-13)12(18)10-2-3-11(15-8-10)17-7-5-14-9-17;1-2/h2-3,5,7-9H,4,6,13H2,1H3;2H2,1H3 |
| InChIKey | AFNHHHIMDREGGG-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |