C28H40N8O3 — CID 142232322
2-[6-(3-amino-5-methylphenyl)-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetamide;4-methylbenzenecarboximidamide;N-propan-2-ylformamide (PubChem CID 142232322) has the molecular formula C28H40N8O3 and a molecular weight of 536.68 g/mol. Its IUPAC name is 2-[6-(3-amino-5-methylphenyl)-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetamide;4-methylbenzenecarboximidamide;N-propan-2-ylformamide.
| Compound Name | 2-[6-(3-amino-5-methylphenyl)-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetamide;4-methylbenzenecarboximidamide;N-propan-2-ylformamide |
|---|---|
| PubChem CID | 142232322 |
| Molecular Formula | C28H40N8O3 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.32 |
| IUPAC Name | 2-[6-(3-amino-5-methylphenyl)-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]acetamide;4-methylbenzenecarboximidamide;N-propan-2-ylformamide |
| SMILES | CC(C)NC=O.Cc1cc(N)cc(-c2cnc(NC(C)C)c(=O)n2CC(N)=O)c1.[H]/N=C(\N)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H21N5O2.C8H10N2.C4H9NO/c1-9(2)20-15-16(23)21(8-14(18)22)13(7-19-15)11-4-10(3)5-12(17)6-11;1-6-2-4-7(5-3-6)8(9)10;1-4(2)5-3-6/h4-7,9H,8,17H2,1-3H3,(H2,18,22)(H,19,20);2-5H,1H3,(H3,9,10);3-4H,1-2H3,(H,5,6) |
| InChIKey | RVOOJBLYKVWVNB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 195.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|