C32H39F6N7O8S — CID 142232509
2-[6-(3-amino-5-butylsulfonylphenyl)-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]-N-[(5-carbamimidoylcyclohepta-1,4,6-trien-1-yl)methyl]acetamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 142232509) has the molecular formula C32H39F6N7O8S and a molecular weight of 795.76 g/mol. Its IUPAC name is 2-[6-(3-amino-5-butylsulfonylphenyl)-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]-N-[(5-carbamimidoylcyclohepta-1,4,6-trien-1-yl)methyl]acetamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[6-(3-amino-5-butylsulfonylphenyl)-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]-N-[(5-carbamimidoylcyclohepta-1,4,6-trien-1-yl)methyl]acetamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 142232509 |
| Molecular Formula | C32H39F6N7O8S |
| Molecular Weight | 795.76 g/mol |
| Exact Mass | 795.25 |
| IUPAC Name | 2-[6-(3-amino-5-butylsulfonylphenyl)-2-oxo-3-(propan-2-ylamino)pyrazin-1-yl]-N-[(5-carbamimidoylcyclohepta-1,4,6-trien-1-yl)methyl]acetamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.[H]/N=C(\N)C1=CCC=C(CNC(=O)Cn2c(-c3cc(N)cc(S(=O)(=O)CCCC)c3)cnc(NC(C)C)c2=O)C=C1 |
| InChI | InChI=1S/C28H37N7O4S.2C2HF3O2/c1-4-5-11-40(38,39)23-13-21(12-22(29)14-23)24-16-33-27(34-18(2)3)28(37)35(24)17-25(36)32-15-19-7-6-8-20(10-9-19)26(30)31;2*3-2(4,5)1(6)7/h7-10,12-14,16,18H,4-6,11,15,17,29H2,1-3H3,(H3,30,31)(H,32,36)(H,33,34);2*(H,6,7) |
| InChIKey | BKLQTKRODBPCCM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 260.65 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.76 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|