N-methyl-1-(1-methylpiperidin-4-yl)methanamine;molecular hydrogen

C8H20N2 — CID 142232985

IUPACN-methyl-1-(1-methylpiperidin-4-yl)methanamine;molecular hydrogen
SMILESCNCC1CCN(C)CC1.[H][H]
InChIInChI=1S/C8H18N2.H2/c1-9-7-8-3-5-10(2)6-4-8;/h8-9H,3-7H2,1-2H3;1H
InChIKeyXHDVSGQWRVWJNS-UHFFFAOYSA-N
MW144.26 g/mol
LogP0.79
Rot. Bonds2

About N-methyl-1-(1-methylpiperidin-4-yl)methanamine;molecular hydrogen

N-methyl-1-(1-methylpiperidin-4-yl)methanamine;molecular hydrogen (PubChem CID 142232985) has the molecular formula C8H20N2 and a molecular weight of 144.26 g/mol. Its IUPAC name is N-methyl-1-(1-methylpiperidin-4-yl)methanamine;molecular hydrogen.

Molecular Properties

Compound NameN-methyl-1-(1-methylpiperidin-4-yl)methanamine;molecular hydrogen
PubChem CID142232985
Molecular FormulaC8H20N2
Molecular Weight144.26 g/mol
Exact Mass144.16
IUPAC NameN-methyl-1-(1-methylpiperidin-4-yl)methanamine;molecular hydrogen
SMILESCNCC1CCN(C)CC1.[H][H]
InChIInChI=1S/C8H18N2.H2/c1-9-7-8-3-5-10(2)6-4-8;/h8-9H,3-7H2,1-2H3;1H
InChIKeyXHDVSGQWRVWJNS-UHFFFAOYSA-N
XLogP0.79
TPSA15.27 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500144.26
LogP ≤ 50.79
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze N-methyl-1-(1-methylpiperidin-4-yl)methanamine;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-methyl-1-(1-methylpiperidin-4-yl)methanamine;molecular hydrogen?
The IUPAC name of N-methyl-1-(1-methylpiperidin-4-yl)methanamine;molecular hydrogen (CID 142232985) is N-methyl-1-(1-methylpiperidin-4-yl)methanamine;molecular hydrogen.
What is the SMILES notation for N-methyl-1-(1-methylpiperidin-4-yl)methanamine;molecular hydrogen?
The canonical SMILES for N-methyl-1-(1-methylpiperidin-4-yl)methanamine;molecular hydrogen is CNCC1CCN(C)CC1.[H][H].
What is the InChIKey of N-methyl-1-(1-methylpiperidin-4-yl)methanamine;molecular hydrogen?
The InChIKey is XHDVSGQWRVWJNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2.H2/c1-9-7-8-3-5-10(2)6-4-8;/h8-9H,3-7H2,1-2H3;1H.
What are the key properties of N-methyl-1-(1-methylpiperidin-4-yl)methanamine;molecular hydrogen?
N-methyl-1-(1-methylpiperidin-4-yl)methanamine;molecular hydrogen has a molecular weight of 144.26 g/mol, XLogP of 0.79, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(1-methylpiperidin-4-yl)methanamine;molecular hydrogen is sourced from PubChem (CID 142232985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).