About 7-(2,2-dimethylpropyl)-2,5-dimethyl-4H-azepine
7-(2,2-dimethylpropyl)-2,5-dimethyl-4H-azepine (PubChem CID 142233577) has the molecular formula C13H21N
and a molecular weight of 191.32 g/mol. Its IUPAC name is 7-(2,2-dimethylpropyl)-2,5-dimethyl-4H-azepine.
Molecular Properties
| Compound Name | 7-(2,2-dimethylpropyl)-2,5-dimethyl-4H-azepine |
| PubChem CID | 142233577 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 7-(2,2-dimethylpropyl)-2,5-dimethyl-4H-azepine |
| SMILES | CC1=CC(CC(C)(C)C)=NC(C)=CC1 |
| InChI | InChI=1S/C13H21N/c1-10-6-7-11(2)14-12(8-10)9-13(3,4)5/h7-8H,6,9H2,1-5H3 |
| InChIKey | WAQLHZZVQKSXLL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-(2,2-dimethylpropyl)-2,5-dimethyl-4H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2,2-dimethylpropyl)-2,5-dimethyl-4H-azepine?
The IUPAC name of 7-(2,2-dimethylpropyl)-2,5-dimethyl-4H-azepine (CID 142233577) is 7-(2,2-dimethylpropyl)-2,5-dimethyl-4H-azepine.
What is the SMILES notation for 7-(2,2-dimethylpropyl)-2,5-dimethyl-4H-azepine?
The canonical SMILES for 7-(2,2-dimethylpropyl)-2,5-dimethyl-4H-azepine is CC1=CC(CC(C)(C)C)=NC(C)=CC1.
What is the InChIKey of 7-(2,2-dimethylpropyl)-2,5-dimethyl-4H-azepine?
The InChIKey is WAQLHZZVQKSXLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N/c1-10-6-7-11(2)14-12(8-10)9-13(3,4)5/h7-8H,6,9H2,1-5H3.
What are the key properties of 7-(2,2-dimethylpropyl)-2,5-dimethyl-4H-azepine?
7-(2,2-dimethylpropyl)-2,5-dimethyl-4H-azepine has a molecular weight of 191.32 g/mol, XLogP of 4.12, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2,2-dimethylpropyl)-2,5-dimethyl-4H-azepine is sourced from PubChem (CID 142233577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).