C15H21NO3 — CID 142233831
(2E,4Z,6Z)-N-formyl-N-(4-hydroxycyclohexyl)octa-2,4,6-trienamide (PubChem CID 142233831) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is (2E,4Z,6Z)-N-formyl-N-(4-hydroxycyclohexyl)octa-2,4,6-trienamide.
| Compound Name | (2E,4Z,6Z)-N-formyl-N-(4-hydroxycyclohexyl)octa-2,4,6-trienamide |
|---|---|
| PubChem CID | 142233831 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | (2E,4Z,6Z)-N-formyl-N-(4-hydroxycyclohexyl)octa-2,4,6-trienamide |
| SMILES | C/C=C\C=C/C=C/C(=O)N(C=O)C1CCC(O)CC1 |
| InChI | InChI=1S/C15H21NO3/c1-2-3-4-5-6-7-15(19)16(12-17)13-8-10-14(18)11-9-13/h2-7,12-14,18H,8-11H2,1H3/b3-2-,5-4-,7-6+ |
| InChIKey | INWXDNLTOJRCIY-MUVPYGFYSA-N |
| XLogP | 1.96 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|