About 3-[[4-(benzylamino)-2,5-dioxopyrrol-3-yl]amino]-2-hydroxybenzaldehyde
3-[[4-(benzylamino)-2,5-dioxopyrrol-3-yl]amino]-2-hydroxybenzaldehyde (PubChem CID 142234016) has the molecular formula C18H15N3O4
and a molecular weight of 337.33 g/mol. Its IUPAC name is 3-[[4-(benzylamino)-2,5-dioxopyrrol-3-yl]amino]-2-hydroxybenzaldehyde.
Molecular Properties
| Compound Name | 3-[[4-(benzylamino)-2,5-dioxopyrrol-3-yl]amino]-2-hydroxybenzaldehyde |
| PubChem CID | 142234016 |
| Molecular Formula | C18H15N3O4 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 3-[[4-(benzylamino)-2,5-dioxopyrrol-3-yl]amino]-2-hydroxybenzaldehyde |
| SMILES | O=Cc1cccc(NC2=C(NCc3ccccc3)C(=O)NC2=O)c1O |
| InChI | InChI=1S/C18H15N3O4/c22-10-12-7-4-8-13(16(12)23)20-15-14(17(24)21-18(15)25)19-9-11-5-2-1-3-6-11/h1-8,10,23H,9H2,(H3,19,20,21,24,25) |
| InChIKey | PZOZOEGQXAKIKH-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-[[4-(benzylamino)-2,5-dioxopyrrol-3-yl]amino]-2-hydroxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(benzylamino)-2,5-dioxopyrrol-3-yl]amino]-2-hydroxybenzaldehyde?
The IUPAC name of 3-[[4-(benzylamino)-2,5-dioxopyrrol-3-yl]amino]-2-hydroxybenzaldehyde (CID 142234016) is 3-[[4-(benzylamino)-2,5-dioxopyrrol-3-yl]amino]-2-hydroxybenzaldehyde.
What is the SMILES notation for 3-[[4-(benzylamino)-2,5-dioxopyrrol-3-yl]amino]-2-hydroxybenzaldehyde?
The canonical SMILES for 3-[[4-(benzylamino)-2,5-dioxopyrrol-3-yl]amino]-2-hydroxybenzaldehyde is O=Cc1cccc(NC2=C(NCc3ccccc3)C(=O)NC2=O)c1O.
What is the InChIKey of 3-[[4-(benzylamino)-2,5-dioxopyrrol-3-yl]amino]-2-hydroxybenzaldehyde?
The InChIKey is PZOZOEGQXAKIKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3O4/c22-10-12-7-4-8-13(16(12)23)20-15-14(17(24)21-18(15)25)19-9-11-5-2-1-3-6-11/h1-8,10,23H,9H2,(H3,19,20,21,24,25).
What are the key properties of 3-[[4-(benzylamino)-2,5-dioxopyrrol-3-yl]amino]-2-hydroxybenzaldehyde?
3-[[4-(benzylamino)-2,5-dioxopyrrol-3-yl]amino]-2-hydroxybenzaldehyde has a molecular weight of 337.33 g/mol, XLogP of 1.27, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(benzylamino)-2,5-dioxopyrrol-3-yl]amino]-2-hydroxybenzaldehyde is sourced from PubChem (CID 142234016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).