C11H18F2N2 — CID 142234261
N'-ethyl-N'-fluoro-N-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-N-methylethane-1,2-diamine (PubChem CID 142234261) has the molecular formula C11H18F2N2 and a molecular weight of 216.27 g/mol. Its IUPAC name is N'-ethyl-N'-fluoro-N-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-N-methylethane-1,2-diamine.
| Compound Name | N'-ethyl-N'-fluoro-N-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 142234261 |
| Molecular Formula | C11H18F2N2 |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | N'-ethyl-N'-fluoro-N-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-N-methylethane-1,2-diamine |
| SMILES | C=C(F)/C=C\C(=C)N(C)CCN(F)CC |
| InChI | InChI=1S/C11H18F2N2/c1-5-15(13)9-8-14(4)11(3)7-6-10(2)12/h6-7H,2-3,5,8-9H2,1,4H3/b7-6- |
| InChIKey | DPYPXTYCGCVUBF-SREVYHEPSA-N |
| XLogP | 2.68 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|