C29H37N5O2 — CID 142234594
N-(2-amino-2-oxo-1-phenylethyl)cyclohexanecarboxamide;3-(piperazin-1-ylmethyl)quinoline (PubChem CID 142234594) has the molecular formula C29H37N5O2 and a molecular weight of 487.65 g/mol. Its IUPAC name is N-(2-amino-2-oxo-1-phenylethyl)cyclohexanecarboxamide;3-(piperazin-1-ylmethyl)quinoline.
| Compound Name | N-(2-amino-2-oxo-1-phenylethyl)cyclohexanecarboxamide;3-(piperazin-1-ylmethyl)quinoline |
|---|---|
| PubChem CID | 142234594 |
| Molecular Formula | C29H37N5O2 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.29 |
| IUPAC Name | N-(2-amino-2-oxo-1-phenylethyl)cyclohexanecarboxamide;3-(piperazin-1-ylmethyl)quinoline |
| SMILES | NC(=O)C(NC(=O)C1CCCCC1)c1ccccc1.c1ccc2ncc(CN3CCNCC3)cc2c1 |
| InChI | InChI=1S/C15H20N2O2.C14H17N3/c16-14(18)13(11-7-3-1-4-8-11)17-15(19)12-9-5-2-6-10-12;1-2-4-14-13(3-1)9-12(10-16-14)11-17-7-5-15-6-8-17/h1,3-4,7-8,12-13H,2,5-6,9-10H2,(H2,16,18)(H,17,19);1-4,9-10,15H,5-8,11H2 |
| InChIKey | NFTUGKOHQHIGJL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |