C21H28N2O3S — CID 142234856
ethyl 4-[[[5-methyl-2-(methylamino)benzoyl]amino]methyl]benzoate;methylsulfanylmethane (PubChem CID 142234856) has the molecular formula C21H28N2O3S and a molecular weight of 388.53 g/mol. Its IUPAC name is ethyl 4-[[[5-methyl-2-(methylamino)benzoyl]amino]methyl]benzoate;methylsulfanylmethane.
| Compound Name | ethyl 4-[[[5-methyl-2-(methylamino)benzoyl]amino]methyl]benzoate;methylsulfanylmethane |
|---|---|
| PubChem CID | 142234856 |
| Molecular Formula | C21H28N2O3S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | ethyl 4-[[[5-methyl-2-(methylamino)benzoyl]amino]methyl]benzoate;methylsulfanylmethane |
| SMILES | CCOC(=O)c1ccc(CNC(=O)c2cc(C)ccc2NC)cc1.CSC |
| InChI | InChI=1S/C19H22N2O3.C2H6S/c1-4-24-19(23)15-8-6-14(7-9-15)12-21-18(22)16-11-13(2)5-10-17(16)20-3;1-3-2/h5-11,20H,4,12H2,1-3H3,(H,21,22);1-2H3 |
| InChIKey | GUHCESMFBKFUPW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |