About 4-tert-butyl-7-ethyl-2,3-dihydro-1H-indene
4-tert-butyl-7-ethyl-2,3-dihydro-1H-indene (PubChem CID 142235418) has the molecular formula C15H22
and a molecular weight of 202.34 g/mol. Its IUPAC name is 4-tert-butyl-7-ethyl-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | 4-tert-butyl-7-ethyl-2,3-dihydro-1H-indene |
| PubChem CID | 142235418 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 4-tert-butyl-7-ethyl-2,3-dihydro-1H-indene |
| SMILES | CCc1ccc(C(C)(C)C)c2c1CCC2 |
| InChI | InChI=1S/C15H22/c1-5-11-9-10-14(15(2,3)4)13-8-6-7-12(11)13/h9-10H,5-8H2,1-4H3 |
| InChIKey | JBORDRRWKPUBTK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-tert-butyl-7-ethyl-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-7-ethyl-2,3-dihydro-1H-indene?
The IUPAC name of 4-tert-butyl-7-ethyl-2,3-dihydro-1H-indene (CID 142235418) is 4-tert-butyl-7-ethyl-2,3-dihydro-1H-indene.
What is the SMILES notation for 4-tert-butyl-7-ethyl-2,3-dihydro-1H-indene?
The canonical SMILES for 4-tert-butyl-7-ethyl-2,3-dihydro-1H-indene is CCc1ccc(C(C)(C)C)c2c1CCC2.
What is the InChIKey of 4-tert-butyl-7-ethyl-2,3-dihydro-1H-indene?
The InChIKey is JBORDRRWKPUBTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22/c1-5-11-9-10-14(15(2,3)4)13-8-6-7-12(11)13/h9-10H,5-8H2,1-4H3.
What are the key properties of 4-tert-butyl-7-ethyl-2,3-dihydro-1H-indene?
4-tert-butyl-7-ethyl-2,3-dihydro-1H-indene has a molecular weight of 202.34 g/mol, XLogP of 4.04, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-7-ethyl-2,3-dihydro-1H-indene is sourced from PubChem (CID 142235418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).